|
@@ -0,0 +1,3200 @@
|
|
|
+/* jquery.nicescroll
|
|
|
+-- version 3.5.1
|
|
|
+-- copyright 2011-12-13 InuYaksa*2013
|
|
|
+-- licensed under the MIT
|
|
|
+--
|
|
|
+-- http://areaaperta.com/nicescroll
|
|
|
+-- https://github.com/inuyaksa/jquery.nicescroll
|
|
|
+--
|
|
|
+*/
|
|
|
+
|
|
|
+(function(jQuery){
|
|
|
+
|
|
|
+ // globals
|
|
|
+ var domfocus = false;
|
|
|
+ var mousefocus = false;
|
|
|
+ var zoomactive = false;
|
|
|
+ var tabindexcounter = 5000;
|
|
|
+ var ascrailcounter = 2000;
|
|
|
+ var globalmaxzindex = 0;
|
|
|
+
|
|
|
+ var $ = jQuery; // sandbox
|
|
|
+
|
|
|
+ // http://stackoverflow.com/questions/2161159/get-script-path
|
|
|
+ function getScriptPath() {
|
|
|
+ var scripts=document.getElementsByTagName('script');
|
|
|
+ var path=scripts[scripts.length-1].src.split('?')[0];
|
|
|
+ return (path.split('/').length>0) ? path.split('/').slice(0,-1).join('/')+'/' : '';
|
|
|
+ }
|
|
|
+ var scriptpath = getScriptPath();
|
|
|
+
|
|
|
+ var vendors = ['ms','moz','webkit','o'];
|
|
|
+
|
|
|
+ var setAnimationFrame = window.requestAnimationFrame||false;
|
|
|
+ var clearAnimationFrame = window.cancelAnimationFrame||false;
|
|
|
+
|
|
|
+ if (!setAnimationFrame) {
|
|
|
+ for(var vx in vendors) {
|
|
|
+ var v = vendors[vx];
|
|
|
+ if (!setAnimationFrame) setAnimationFrame = window[v+'RequestAnimationFrame'];
|
|
|
+ if (!clearAnimationFrame) clearAnimationFrame = window[v+'CancelAnimationFrame']||window[v+'CancelRequestAnimationFrame'];
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ var clsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
|
|
|
+
|
|
|
+ var _globaloptions = {
|
|
|
+ zindex:"auto",
|
|
|
+ cursoropacitymin:0,
|
|
|
+ cursoropacitymax:1,
|
|
|
+ cursorcolor:"#424242",
|
|
|
+ cursorwidth:"5px",
|
|
|
+ cursorborder:"1px solid #fff",
|
|
|
+ cursorborderradius:"5px",
|
|
|
+ scrollspeed:60,
|
|
|
+ mousescrollstep:8*3,
|
|
|
+ touchbehavior:false,
|
|
|
+ hwacceleration:true,
|
|
|
+ usetransition:true,
|
|
|
+ boxzoom:false,
|
|
|
+ dblclickzoom:true,
|
|
|
+ gesturezoom:true,
|
|
|
+ grabcursorenabled:true,
|
|
|
+ autohidemode:true,
|
|
|
+ background:"",
|
|
|
+ iframeautoresize:true,
|
|
|
+ cursorminheight:32,
|
|
|
+ preservenativescrolling:true,
|
|
|
+ railoffset:false,
|
|
|
+ bouncescroll:true,
|
|
|
+ spacebarenabled:true,
|
|
|
+ railpadding:{top:0,right:0,left:0,bottom:0},
|
|
|
+ disableoutline:true,
|
|
|
+ horizrailenabled:true,
|
|
|
+ railalign:"right",
|
|
|
+ railvalign:"bottom",
|
|
|
+ enabletranslate3d:true,
|
|
|
+ enablemousewheel:true,
|
|
|
+ enablekeyboard:true,
|
|
|
+ smoothscroll:true,
|
|
|
+ sensitiverail:true,
|
|
|
+ enablemouselockapi:true,
|
|
|
+// cursormaxheight:false,
|
|
|
+ cursorfixedheight:false,
|
|
|
+ directionlockdeadzone:6,
|
|
|
+ hidecursordelay:400,
|
|
|
+ nativeparentscrolling:true,
|
|
|
+ enablescrollonselection:true,
|
|
|
+ overflowx:true,
|
|
|
+ overflowy:true,
|
|
|
+ cursordragspeed:0.3,
|
|
|
+ rtlmode:false,
|
|
|
+ cursordragontouch:false,
|
|
|
+ oneaxismousemode:"auto"
|
|
|
+ }
|
|
|
+
|
|
|
+ var browserdetected = false;
|
|
|
+
|
|
|
+ var getBrowserDetection = function() {
|
|
|
+
|
|
|
+ if (browserdetected) return browserdetected;
|
|
|
+
|
|
|
+ var domtest = document.createElement('DIV');
|
|
|
+
|
|
|
+ var d = {};
|
|
|
+
|
|
|
+ d.haspointerlock = "pointerLockElement" in document || "mozPointerLockElement" in document || "webkitPointerLockElement" in document;
|
|
|
+
|
|
|
+ d.isopera = ("opera" in window);
|
|
|
+ d.isopera12 = (d.isopera&&("getUserMedia" in navigator));
|
|
|
+ d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
|
|
|
+
|
|
|
+ d.isie = (("all" in document) && ("attachEvent" in domtest) && !d.isopera);
|
|
|
+ d.isieold = (d.isie && !("msInterpolationMode" in domtest.style)); // IE6 and older
|
|
|
+ d.isie7 = d.isie&&!d.isieold&&(!("documentMode" in document)||(document.documentMode==7));
|
|
|
+ d.isie8 = d.isie&&("documentMode" in document)&&(document.documentMode==8);
|
|
|
+ d.isie9 = d.isie&&("performance" in window)&&(document.documentMode>=9);
|
|
|
+ d.isie10 = d.isie&&("performance" in window)&&(document.documentMode>=10);
|
|
|
+
|
|
|
+ d.isie9mobile = /iemobile.9/i.test(navigator.userAgent); //wp 7.1 mango
|
|
|
+ if (d.isie9mobile) d.isie9 = false;
|
|
|
+ d.isie7mobile = (!d.isie9mobile&&d.isie7) && /iemobile/i.test(navigator.userAgent); //wp 7.0
|
|
|
+
|
|
|
+ d.ismozilla = ("MozAppearance" in domtest.style);
|
|
|
+
|
|
|
+ d.iswebkit = ("WebkitAppearance" in domtest.style);
|
|
|
+
|
|
|
+ d.ischrome = ("chrome" in window);
|
|
|
+ d.ischrome22 = (d.ischrome&&d.haspointerlock);
|
|
|
+ d.ischrome26 = (d.ischrome&&("transition" in domtest.style)); // issue with transform detection (maintain prefix)
|
|
|
+
|
|
|
+ d.cantouch = ("ontouchstart" in document.documentElement)||("ontouchstart" in window); // detection for Chrome Touch Emulation
|
|
|
+ d.hasmstouch = (window.navigator.msPointerEnabled||false); // IE10+ pointer events
|
|
|
+
|
|
|
+ d.ismac = /^mac$/i.test(navigator.platform);
|
|
|
+
|
|
|
+ d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform));
|
|
|
+ d.isios4 = ((d.isios)&&!("seal" in Object));
|
|
|
+
|
|
|
+ d.isandroid = (/android/i.test(navigator.userAgent));
|
|
|
+
|
|
|
+ d.trstyle = false;
|
|
|
+ d.hastransform = false;
|
|
|
+ d.hastranslate3d = false;
|
|
|
+ d.transitionstyle = false;
|
|
|
+ d.hastransition = false;
|
|
|
+ d.transitionend = false;
|
|
|
+
|
|
|
+ var check = ['transform','msTransform','webkitTransform','MozTransform','OTransform'];
|
|
|
+ for(var a=0;a<check.length;a++){
|
|
|
+ if (typeof domtest.style[check[a]] != "undefined") {
|
|
|
+ d.trstyle = check[a];
|
|
|
+ break;
|
|
|
+ }
|
|
|
+ }
|
|
|
+ d.hastransform = (d.trstyle != false);
|
|
|
+ if (d.hastransform) {
|
|
|
+ domtest.style[d.trstyle] = "translate3d(1px,2px,3px)";
|
|
|
+ d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]);
|
|
|
+ }
|
|
|
+
|
|
|
+ d.transitionstyle = false;
|
|
|
+ d.prefixstyle = '';
|
|
|
+ d.transitionend = false;
|
|
|
+ var check = ['transition','webkitTransition','MozTransition','OTransition','OTransition','msTransition','KhtmlTransition'];
|
|
|
+ var prefix = ['','-webkit-','-moz-','-o-','-o','-ms-','-khtml-'];
|
|
|
+ var evs = ['transitionend','webkitTransitionEnd','transitionend','otransitionend','oTransitionEnd','msTransitionEnd','KhtmlTransitionEnd'];
|
|
|
+ for(var a=0;a<check.length;a++) {
|
|
|
+ if (check[a] in domtest.style) {
|
|
|
+ d.transitionstyle = check[a];
|
|
|
+ d.prefixstyle = prefix[a];
|
|
|
+ d.transitionend = evs[a];
|
|
|
+ break;
|
|
|
+ }
|
|
|
+ }
|
|
|
+ if (d.ischrome26) { // use always prefix
|
|
|
+ d.prefixstyle = prefix[1];
|
|
|
+ }
|
|
|
+
|
|
|
+ d.hastransition = (d.transitionstyle);
|
|
|
+
|
|
|
+ function detectCursorGrab() {
|
|
|
+ var lst = ['-moz-grab','-webkit-grab','grab'];
|
|
|
+ if ((d.ischrome&&!d.ischrome22)||d.isie) lst=[]; // force setting for IE returns false positive and chrome cursor bug
|
|
|
+ for(var a=0;a<lst.length;a++) {
|
|
|
+ var p = lst[a];
|
|
|
+ domtest.style['cursor']=p;
|
|
|
+ if (domtest.style['cursor']==p) return p;
|
|
|
+ }
|
|
|
+ return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize'; // thank you google for custom cursor!
|
|
|
+ }
|
|
|
+ d.cursorgrabvalue = detectCursorGrab();
|
|
|
+
|
|
|
+ d.hasmousecapture = ("setCapture" in domtest);
|
|
|
+
|
|
|
+ d.hasMutationObserver = (clsMutationObserver !== false);
|
|
|
+
|
|
|
+ domtest = null; //memory released
|
|
|
+
|
|
|
+ browserdetected = d;
|
|
|
+
|
|
|
+ return d;
|
|
|
+ }
|
|
|
+
|
|
|
+ var NiceScrollClass = function(myopt,me) {
|
|
|
+
|
|
|
+ var self = this;
|
|
|
+
|
|
|
+ this.version = '3.5.1';
|
|
|
+ this.name = 'nicescroll';
|
|
|
+
|
|
|
+ this.me = me;
|
|
|
+
|
|
|
+ this.opt = {
|
|
|
+ doc:$("body"),
|
|
|
+ win:false
|
|
|
+ };
|
|
|
+
|
|
|
+ $.extend(this.opt,_globaloptions);
|
|
|
+
|
|
|
+// Options for internal use
|
|
|
+ this.opt.snapbackspeed = 80;
|
|
|
+
|
|
|
+ if (myopt||false) {
|
|
|
+ for(var a in self.opt) {
|
|
|
+ if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a];
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ this.doc = self.opt.doc;
|
|
|
+ this.iddoc = (this.doc&&this.doc[0])?this.doc[0].id||'':'';
|
|
|
+ this.ispage = /BODY|HTML/.test((self.opt.win)?self.opt.win[0].nodeName:this.doc[0].nodeName);
|
|
|
+ this.haswrapper = (self.opt.win!==false);
|
|
|
+ this.win = self.opt.win||(this.ispage?$(window):this.doc);
|
|
|
+ this.docscroll = (this.ispage&&!this.haswrapper)?$(window):this.win;
|
|
|
+ this.body = $("body");
|
|
|
+ this.viewport = false;
|
|
|
+
|
|
|
+ this.isfixed = false;
|
|
|
+
|
|
|
+ this.iframe = false;
|
|
|
+ this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
|
|
|
+
|
|
|
+ this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
|
|
|
+
|
|
|
+ this.forcescreen = false; //force to use screen position on events
|
|
|
+
|
|
|
+ this.canshowonmouseevent = (self.opt.autohidemode!="scroll");
|
|
|
+
|
|
|
+// Events jump table
|
|
|
+ this.onmousedown = false;
|
|
|
+ this.onmouseup = false;
|
|
|
+ this.onmousemove = false;
|
|
|
+ this.onmousewheel = false;
|
|
|
+ this.onkeypress = false;
|
|
|
+ this.ongesturezoom = false;
|
|
|
+ this.onclick = false;
|
|
|
+
|
|
|
+// Nicescroll custom events
|
|
|
+ this.onscrollstart = false;
|
|
|
+ this.onscrollend = false;
|
|
|
+ this.onscrollcancel = false;
|
|
|
+
|
|
|
+ this.onzoomin = false;
|
|
|
+ this.onzoomout = false;
|
|
|
+
|
|
|
+// Let's start!
|
|
|
+ this.view = false;
|
|
|
+ this.page = false;
|
|
|
+
|
|
|
+ this.scroll = {x:0,y:0};
|
|
|
+ this.scrollratio = {x:0,y:0};
|
|
|
+ this.cursorheight = 20;
|
|
|
+ this.scrollvaluemax = 0;
|
|
|
+
|
|
|
+ this.checkrtlmode = false;
|
|
|
+
|
|
|
+ this.scrollrunning = false;
|
|
|
+
|
|
|
+ this.scrollmom = false;
|
|
|
+
|
|
|
+ this.observer = false;
|
|
|
+ this.observerremover = false; // observer on parent for remove detection
|
|
|
+
|
|
|
+ do {
|
|
|
+ this.id = "ascrail"+(ascrailcounter++);
|
|
|
+ } while (document.getElementById(this.id));
|
|
|
+
|
|
|
+ this.rail = false;
|
|
|
+ this.cursor = false;
|
|
|
+ this.cursorfreezed = false;
|
|
|
+ this.selectiondrag = false;
|
|
|
+
|
|
|
+ this.zoom = false;
|
|
|
+ this.zoomactive = false;
|
|
|
+
|
|
|
+ this.hasfocus = false;
|
|
|
+ this.hasmousefocus = false;
|
|
|
+
|
|
|
+ this.visibility = true;
|
|
|
+ this.locked = false;
|
|
|
+ this.hidden = false; // rails always hidden
|
|
|
+ this.cursoractive = true; // user can interact with cursors
|
|
|
+
|
|
|
+ this.overflowx = self.opt.overflowx;
|
|
|
+ this.overflowy = self.opt.overflowy;
|
|
|
+
|
|
|
+ this.nativescrollingarea = false;
|
|
|
+ this.checkarea = 0;
|
|
|
+
|
|
|
+ this.events = []; // event list for unbind
|
|
|
+
|
|
|
+ this.saved = {};
|
|
|
+
|
|
|
+ this.delaylist = {};
|
|
|
+ this.synclist = {};
|
|
|
+
|
|
|
+ this.lastdeltax = 0;
|
|
|
+ this.lastdeltay = 0;
|
|
|
+
|
|
|
+ this.detected = getBrowserDetection();
|
|
|
+
|
|
|
+ var cap = $.extend({},this.detected);
|
|
|
+
|
|
|
+ this.canhwscroll = (cap.hastransform&&self.opt.hwacceleration);
|
|
|
+ this.ishwscroll = (this.canhwscroll&&self.haswrapper);
|
|
|
+
|
|
|
+ this.istouchcapable = false; // desktop devices with touch screen support
|
|
|
+
|
|
|
+//## Check Chrome desktop with touch support
|
|
|
+ if (cap.cantouch&&cap.ischrome&&!cap.isios&&!cap.isandroid) {
|
|
|
+ this.istouchcapable = true;
|
|
|
+ cap.cantouch = false; // parse normal desktop events
|
|
|
+ }
|
|
|
+
|
|
|
+//## Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
|
|
|
+ if (cap.cantouch&&cap.ismozilla&&!cap.isios&&!cap.isandroid) {
|
|
|
+ this.istouchcapable = true;
|
|
|
+ cap.cantouch = false; // parse normal desktop events
|
|
|
+ }
|
|
|
+
|
|
|
+//## disable MouseLock API on user request
|
|
|
+
|
|
|
+ if (!self.opt.enablemouselockapi) {
|
|
|
+ cap.hasmousecapture = false;
|
|
|
+ cap.haspointerlock = false;
|
|
|
+ }
|
|
|
+
|
|
|
+ this.delayed = function(name,fn,tm,lazy) {
|
|
|
+ var dd = self.delaylist[name];
|
|
|
+ var nw = (new Date()).getTime();
|
|
|
+ if (!lazy&&dd&&dd.tt) return false;
|
|
|
+ if (dd&&dd.tt) clearTimeout(dd.tt);
|
|
|
+ if (dd&&dd.last+tm>nw&&!dd.tt) {
|
|
|
+ self.delaylist[name] = {
|
|
|
+ last:nw+tm,
|
|
|
+ tt:setTimeout(function(){self.delaylist[name].tt=0;fn.call();},tm)
|
|
|
+ }
|
|
|
+ }
|
|
|
+ else if (!dd||!dd.tt) {
|
|
|
+ self.delaylist[name] = {
|
|
|
+ last:nw,
|
|
|
+ tt:0
|
|
|
+ }
|
|
|
+ setTimeout(function(){fn.call();},0);
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ this.debounced = function(name,fn,tm) {
|
|
|
+ var dd = self.delaylist[name];
|
|
|
+ var nw = (new Date()).getTime();
|
|
|
+ self.delaylist[name] = fn;
|
|
|
+ if (!dd) {
|
|
|
+ setTimeout(function(){var fn=self.delaylist[name];self.delaylist[name]=false;fn.call();},tm);
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ this.synched = function(name,fn) {
|
|
|
+
|
|
|
+ function requestSync() {
|
|
|
+ if (self.onsync) return;
|
|
|
+ setAnimationFrame(function(){
|
|
|
+ self.onsync = false;
|
|
|
+ for(name in self.synclist){
|
|
|
+ var fn = self.synclist[name];
|
|
|
+ if (fn) fn.call(self);
|
|
|
+ self.synclist[name] = false;
|
|
|
+ }
|
|
|
+ });
|
|
|
+ self.onsync = true;
|
|
|
+ };
|
|
|
+
|
|
|
+ self.synclist[name] = fn;
|
|
|
+ requestSync();
|
|
|
+ return name;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.unsynched = function(name) {
|
|
|
+ if (self.synclist[name]) self.synclist[name] = false;
|
|
|
+ }
|
|
|
+
|
|
|
+ this.css = function(el,pars) { // save & set
|
|
|
+ for(var n in pars) {
|
|
|
+ self.saved.css.push([el,n,el.css(n)]);
|
|
|
+ el.css(n,pars[n]);
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ this.scrollTop = function(val) {
|
|
|
+ return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.scrollLeft = function(val) {
|
|
|
+ return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val);
|
|
|
+ };
|
|
|
+
|
|
|
+// derived by by Dan Pupius www.pupius.net
|
|
|
+ BezierClass = function(st,ed,spd,p1,p2,p3,p4) {
|
|
|
+ this.st = st;
|
|
|
+ this.ed = ed;
|
|
|
+ this.spd = spd;
|
|
|
+
|
|
|
+ this.p1 = p1||0;
|
|
|
+ this.p2 = p2||1;
|
|
|
+ this.p3 = p3||0;
|
|
|
+ this.p4 = p4||1;
|
|
|
+
|
|
|
+ this.ts = (new Date()).getTime();
|
|
|
+ this.df = this.ed-this.st;
|
|
|
+ };
|
|
|
+ BezierClass.prototype = {
|
|
|
+ B2:function(t){ return 3*t*t*(1-t) },
|
|
|
+ B3:function(t){ return 3*t*(1-t)*(1-t) },
|
|
|
+ B4:function(t){ return (1-t)*(1-t)*(1-t) },
|
|
|
+ getNow:function(){
|
|
|
+ var nw = (new Date()).getTime();
|
|
|
+ var pc = 1-((nw-this.ts)/this.spd);
|
|
|
+ var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
|
|
|
+ return (pc<0) ? this.ed : this.st+Math.round(this.df*bz);
|
|
|
+ },
|
|
|
+ update:function(ed,spd){
|
|
|
+ this.st = this.getNow();
|
|
|
+ this.ed = ed;
|
|
|
+ this.spd = spd;
|
|
|
+ this.ts = (new Date()).getTime();
|
|
|
+ this.df = this.ed-this.st;
|
|
|
+ return this;
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ if (this.ishwscroll) {
|
|
|
+ // hw accelerated scroll
|
|
|
+ this.doc.translate = {x:0,y:0,tx:"0px",ty:"0px"};
|
|
|
+
|
|
|
+ //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
|
|
|
+ if (cap.hastranslate3d&&cap.isios) this.doc.css("-webkit-backface-visibility","hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
|
|
|
+
|
|
|
+ //derived from http://stackoverflow.com/questions/11236090/
|
|
|
+ function getMatrixValues() {
|
|
|
+ var tr = self.doc.css(cap.trstyle);
|
|
|
+ if (tr&&(tr.substr(0,6)=="matrix")) {
|
|
|
+ return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g,'').split(/, +/);
|
|
|
+ }
|
|
|
+ return false;
|
|
|
+ }
|
|
|
+
|
|
|
+ this.getScrollTop = function(last) {
|
|
|
+ if (!last) {
|
|
|
+ var mtx = getMatrixValues();
|
|
|
+ if (mtx) return (mtx.length==16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
|
|
|
+ if (self.timerscroll&&self.timerscroll.bz) return self.timerscroll.bz.getNow();
|
|
|
+ }
|
|
|
+ return self.doc.translate.y;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.getScrollLeft = function(last) {
|
|
|
+ if (!last) {
|
|
|
+ var mtx = getMatrixValues();
|
|
|
+ if (mtx) return (mtx.length==16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
|
|
|
+ if (self.timerscroll&&self.timerscroll.bh) return self.timerscroll.bh.getNow();
|
|
|
+ }
|
|
|
+ return self.doc.translate.x;
|
|
|
+ };
|
|
|
+
|
|
|
+ if (document.createEvent) {
|
|
|
+ this.notifyScrollEvent = function(el) {
|
|
|
+ var e = document.createEvent("UIEvents");
|
|
|
+ e.initUIEvent("scroll", false, true, window, 1);
|
|
|
+ el.dispatchEvent(e);
|
|
|
+ };
|
|
|
+ }
|
|
|
+ else if (document.fireEvent) {
|
|
|
+ this.notifyScrollEvent = function(el) {
|
|
|
+ var e = document.createEventObject();
|
|
|
+ el.fireEvent("onscroll");
|
|
|
+ e.cancelBubble = true;
|
|
|
+ };
|
|
|
+ }
|
|
|
+ else {
|
|
|
+ this.notifyScrollEvent = function(el,add) {}; //NOPE
|
|
|
+ }
|
|
|
+
|
|
|
+ if (cap.hastranslate3d&&self.opt.enabletranslate3d) {
|
|
|
+ this.setScrollTop = function(val,silent) {
|
|
|
+ self.doc.translate.y = val;
|
|
|
+ self.doc.translate.ty = (val*-1)+"px";
|
|
|
+ self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)");
|
|
|
+ if (!silent) self.notifyScrollEvent(self.win[0]);
|
|
|
+ };
|
|
|
+ this.setScrollLeft = function(val,silent) {
|
|
|
+ self.doc.translate.x = val;
|
|
|
+ self.doc.translate.tx = (val*-1)+"px";
|
|
|
+ self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)");
|
|
|
+ if (!silent) self.notifyScrollEvent(self.win[0]);
|
|
|
+ };
|
|
|
+ } else {
|
|
|
+ this.setScrollTop = function(val,silent) {
|
|
|
+ self.doc.translate.y = val;
|
|
|
+ self.doc.translate.ty = (val*-1)+"px";
|
|
|
+ self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")");
|
|
|
+ if (!silent) self.notifyScrollEvent(self.win[0]);
|
|
|
+ };
|
|
|
+ this.setScrollLeft = function(val,silent) {
|
|
|
+ self.doc.translate.x = val;
|
|
|
+ self.doc.translate.tx = (val*-1)+"px";
|
|
|
+ self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")");
|
|
|
+ if (!silent) self.notifyScrollEvent(self.win[0]);
|
|
|
+ };
|
|
|
+ }
|
|
|
+ } else {
|
|
|
+ // native scroll
|
|
|
+ this.getScrollTop = function() {
|
|
|
+ return self.docscroll.scrollTop();
|
|
|
+ };
|
|
|
+ this.setScrollTop = function(val) {
|
|
|
+ return self.docscroll.scrollTop(val);
|
|
|
+ };
|
|
|
+ this.getScrollLeft = function() {
|
|
|
+ return self.docscroll.scrollLeft();
|
|
|
+ };
|
|
|
+ this.setScrollLeft = function(val) {
|
|
|
+ return self.docscroll.scrollLeft(val);
|
|
|
+ };
|
|
|
+ }
|
|
|
+
|
|
|
+ this.getTarget = function(e) {
|
|
|
+ if (!e) return false;
|
|
|
+ if (e.target) return e.target;
|
|
|
+ if (e.srcElement) return e.srcElement;
|
|
|
+ return false;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.hasParent = function(e,id) {
|
|
|
+ if (!e) return false;
|
|
|
+ var el = e.target||e.srcElement||e||false;
|
|
|
+ while (el && el.id != id) {
|
|
|
+ el = el.parentNode||false;
|
|
|
+ }
|
|
|
+ return (el!==false);
|
|
|
+ };
|
|
|
+
|
|
|
+ function getZIndex() {
|
|
|
+ var dom = self.win;
|
|
|
+ if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
|
|
|
+ while (dom.length>0) {
|
|
|
+ if (dom[0].nodeType==9) return false;
|
|
|
+ var zi = dom.css('zIndex');
|
|
|
+ if (!isNaN(zi)&&zi!=0) return parseInt(zi);
|
|
|
+ dom = dom.parent();
|
|
|
+ }
|
|
|
+ return false;
|
|
|
+ };
|
|
|
+
|
|
|
+//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
|
|
|
+ var _convertBorderWidth = {"thin":1,"medium":3,"thick":5};
|
|
|
+ function getWidthToPixel(dom,prop,chkheight) {
|
|
|
+ var wd = dom.css(prop);
|
|
|
+ var px = parseFloat(wd);
|
|
|
+ if (isNaN(px)) {
|
|
|
+ px = _convertBorderWidth[wd]||0;
|
|
|
+ var brd = (px==3) ? ((chkheight)?(self.win.outerHeight() - self.win.innerHeight()):(self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
|
|
|
+ if (self.isie8&&px) px+=1;
|
|
|
+ return (brd) ? px : 0;
|
|
|
+ }
|
|
|
+ return px;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.getOffset = function() {
|
|
|
+ if (self.isfixed) return {top:parseFloat(self.win.css('top')),left:parseFloat(self.win.css('left'))};
|
|
|
+ if (!self.viewport) return self.win.offset();
|
|
|
+ var ww = self.win.offset();
|
|
|
+ var vp = self.viewport.offset();
|
|
|
+ return {top:ww.top-vp.top+self.viewport.scrollTop(),left:ww.left-vp.left+self.viewport.scrollLeft()};
|
|
|
+ };
|
|
|
+
|
|
|
+ this.updateScrollBar = function(len) {
|
|
|
+ if (self.ishwscroll) {
|
|
|
+ self.rail.css({height:self.win.innerHeight()});
|
|
|
+ if (self.railh) self.railh.css({width:self.win.innerWidth()});
|
|
|
+ } else {
|
|
|
+ var wpos = self.getOffset();
|
|
|
+ var pos = {top:wpos.top,left:wpos.left};
|
|
|
+ pos.top+= getWidthToPixel(self.win,'border-top-width',true);
|
|
|
+ var brd = (self.win.outerWidth() - self.win.innerWidth())/2;
|
|
|
+ pos.left+= (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win,'border-right-width') - self.rail.width : getWidthToPixel(self.win,'border-left-width');
|
|
|
+
|
|
|
+ var off = self.opt.railoffset;
|
|
|
+ if (off) {
|
|
|
+ if (off.top) pos.top+=off.top;
|
|
|
+ if (self.rail.align&&off.left) pos.left+=off.left;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!self.locked) self.rail.css({top:pos.top,left:pos.left,height:(len)?len.h:self.win.innerHeight()});
|
|
|
+
|
|
|
+ if (self.zoom) {
|
|
|
+ self.zoom.css({top:pos.top+1,left:(self.rail.align==1) ? pos.left-20 : pos.left+self.rail.width+4});
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.railh&&!self.locked) {
|
|
|
+ var pos = {top:wpos.top,left:wpos.left};
|
|
|
+ var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win,'border-top-width',true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win,'border-top-width',true);
|
|
|
+ var x = pos.left + getWidthToPixel(self.win,'border-left-width');
|
|
|
+ self.railh.css({top:y,left:x,width:self.railh.width});
|
|
|
+ }
|
|
|
+
|
|
|
+
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ this.doRailClick = function(e,dbl,hr) {
|
|
|
+
|
|
|
+ var fn,pg,cur,pos;
|
|
|
+
|
|
|
+// if (self.rail.drag&&self.rail.drag.pt!=1) return;
|
|
|
+ if (self.locked) return;
|
|
|
+// if (self.rail.drag) return;
|
|
|
+
|
|
|
+// self.cancelScroll();
|
|
|
+
|
|
|
+ self.cancelEvent(e);
|
|
|
+
|
|
|
+ if (dbl) {
|
|
|
+ fn = (hr) ? self.doScrollLeft : self.doScrollTop;
|
|
|
+ cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth/2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight/2)) * self.scrollratio.y);
|
|
|
+ fn(cur);
|
|
|
+ } else {
|
|
|
+// console.log(e.pageY);
|
|
|
+ fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
|
|
|
+ cur = (hr) ? self.scroll.x : self.scroll.y;
|
|
|
+ pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
|
|
|
+ pg = (hr) ? self.view.w : self.view.h;
|
|
|
+ (cur>=pos) ? fn(pg) : fn(-pg);
|
|
|
+ }
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ self.hasanimationframe = (setAnimationFrame);
|
|
|
+ self.hascancelanimationframe = (clearAnimationFrame);
|
|
|
+
|
|
|
+ if (!self.hasanimationframe) {
|
|
|
+ setAnimationFrame=function(fn){return setTimeout(fn,15-Math.floor((+new Date)/1000)%16)}; // 1000/60)};
|
|
|
+ clearAnimationFrame=clearInterval;
|
|
|
+ }
|
|
|
+ else if (!self.hascancelanimationframe) clearAnimationFrame=function(){self.cancelAnimationFrame=true};
|
|
|
+
|
|
|
+ this.init = function() {
|
|
|
+
|
|
|
+ self.saved.css = [];
|
|
|
+
|
|
|
+ if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
|
|
|
+ if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
|
|
|
+
|
|
|
+ if (cap.hasmstouch) self.css((self.ispage)?$("html"):self.win,{'-ms-touch-action':'none'});
|
|
|
+
|
|
|
+ self.zindex = "auto";
|
|
|
+ if (!self.ispage&&self.opt.zindex=="auto") {
|
|
|
+ self.zindex = getZIndex()||"auto";
|
|
|
+ } else {
|
|
|
+ self.zindex = self.opt.zindex;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!self.ispage&&self.zindex!="auto") {
|
|
|
+ if (self.zindex>globalmaxzindex) globalmaxzindex=self.zindex;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.isie&&self.zindex==0&&self.opt.zindex=="auto") { // fix IE auto == 0
|
|
|
+ self.zindex="auto";
|
|
|
+ }
|
|
|
+
|
|
|
+/*
|
|
|
+ self.ispage = true;
|
|
|
+ self.haswrapper = true;
|
|
|
+// self.win = $(window);
|
|
|
+ self.docscroll = $("body");
|
|
|
+// self.doc = $("body");
|
|
|
+*/
|
|
|
+
|
|
|
+ if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
|
|
|
+
|
|
|
+ var cont = self.docscroll;
|
|
|
+ if (self.ispage) cont = (self.haswrapper)?self.win:self.doc;
|
|
|
+
|
|
|
+ if (!cap.isie9mobile) self.css(cont,{'overflow-y':'hidden'});
|
|
|
+
|
|
|
+ if (self.ispage&&cap.isie7) {
|
|
|
+ if (self.doc[0].nodeName=='BODY') self.css($("html"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue
|
|
|
+ else if (self.doc[0].nodeName=='HTML') self.css($("body"),{'overflow-y':'hidden'}); //IE7 double scrollbar issue
|
|
|
+ }
|
|
|
+
|
|
|
+ if (cap.isios&&!self.ispage&&!self.haswrapper) self.css($("body"),{"-webkit-overflow-scrolling":"touch"}); //force hw acceleration
|
|
|
+
|
|
|
+ var cursor = $(document.createElement('div'));
|
|
|
+ cursor.css({
|
|
|
+ position:"relative",top:0,"float":"right",width:self.opt.cursorwidth,height:"0px",
|
|
|
+ 'background-color':self.opt.cursorcolor,
|
|
|
+ border:self.opt.cursorborder,
|
|
|
+ 'background-clip':'padding-box',
|
|
|
+ '-webkit-border-radius':self.opt.cursorborderradius,
|
|
|
+ '-moz-border-radius':self.opt.cursorborderradius,
|
|
|
+ 'border-radius':self.opt.cursorborderradius
|
|
|
+ });
|
|
|
+
|
|
|
+ cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
|
|
|
+ self.cursor = cursor;
|
|
|
+
|
|
|
+ var rail = $(document.createElement('div'));
|
|
|
+ rail.attr('id',self.id);
|
|
|
+ rail.addClass('nicescroll-rails');
|
|
|
+
|
|
|
+ var v,a,kp = ["left","right"]; //"top","bottom"
|
|
|
+ for(var n in kp) {
|
|
|
+ a=kp[n];
|
|
|
+ v = self.opt.railpadding[a];
|
|
|
+ (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
|
|
|
+ }
|
|
|
+
|
|
|
+ rail.append(cursor);
|
|
|
+
|
|
|
+ rail.width = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerWidth()) + self.opt.railpadding['left'] + self.opt.railpadding['right'];
|
|
|
+ rail.css({width:rail.width+"px",'zIndex':self.zindex,"background":self.opt.background,cursor:"default"});
|
|
|
+
|
|
|
+ rail.visibility = true;
|
|
|
+ rail.scrollable = true;
|
|
|
+
|
|
|
+ rail.align = (self.opt.railalign=="left") ? 0 : 1;
|
|
|
+
|
|
|
+ self.rail = rail;
|
|
|
+
|
|
|
+ self.rail.drag = false;
|
|
|
+
|
|
|
+ var zoom = false;
|
|
|
+ if (self.opt.boxzoom&&!self.ispage&&!cap.isieold) {
|
|
|
+ zoom = document.createElement('div');
|
|
|
+ self.bind(zoom,"click",self.doZoom);
|
|
|
+ self.zoom = $(zoom);
|
|
|
+ self.zoom.css({"cursor":"pointer",'z-index':self.zindex,'backgroundImage':'url('+scriptpath+'zoomico.png)','height':18,'width':18,'backgroundPosition':'0px 0px'});
|
|
|
+ if (self.opt.dblclickzoom) self.bind(self.win,"dblclick",self.doZoom);
|
|
|
+ if (cap.cantouch&&self.opt.gesturezoom) {
|
|
|
+ self.ongesturezoom = function(e) {
|
|
|
+ if (e.scale>1.5) self.doZoomIn(e);
|
|
|
+ if (e.scale<0.8) self.doZoomOut(e);
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ };
|
|
|
+ self.bind(self.win,"gestureend",self.ongesturezoom);
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+// init HORIZ
|
|
|
+
|
|
|
+ self.railh = false;
|
|
|
+
|
|
|
+ if (self.opt.horizrailenabled) {
|
|
|
+
|
|
|
+ self.css(cont,{'overflow-x':'hidden'});
|
|
|
+
|
|
|
+ var cursor = $(document.createElement('div'));
|
|
|
+ cursor.css({
|
|
|
+ position:"relative",top:0,height:self.opt.cursorwidth,width:"0px",
|
|
|
+ 'background-color':self.opt.cursorcolor,
|
|
|
+ border:self.opt.cursorborder,
|
|
|
+ 'background-clip':'padding-box',
|
|
|
+ '-webkit-border-radius':self.opt.cursorborderradius,
|
|
|
+ '-moz-border-radius':self.opt.cursorborderradius,
|
|
|
+ 'border-radius':self.opt.cursorborderradius
|
|
|
+ });
|
|
|
+
|
|
|
+ cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
|
|
|
+ self.cursorh = cursor;
|
|
|
+
|
|
|
+ var railh = $(document.createElement('div'));
|
|
|
+ railh.attr('id',self.id+'-hr');
|
|
|
+ railh.addClass('nicescroll-rails');
|
|
|
+ railh.height = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerHeight());
|
|
|
+ railh.css({height:railh.height+"px",'zIndex':self.zindex,"background":self.opt.background});
|
|
|
+
|
|
|
+ railh.append(cursor);
|
|
|
+
|
|
|
+ railh.visibility = true;
|
|
|
+ railh.scrollable = true;
|
|
|
+
|
|
|
+ railh.align = (self.opt.railvalign=="top") ? 0 : 1;
|
|
|
+
|
|
|
+ self.railh = railh;
|
|
|
+
|
|
|
+ self.railh.drag = false;
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+//
|
|
|
+
|
|
|
+ if (self.ispage) {
|
|
|
+ rail.css({position:"fixed",top:"0px",height:"100%"});
|
|
|
+ (rail.align) ? rail.css({right:"0px"}) : rail.css({left:"0px"});
|
|
|
+ self.body.append(rail);
|
|
|
+ if (self.railh) {
|
|
|
+ railh.css({position:"fixed",left:"0px",width:"100%"});
|
|
|
+ (railh.align) ? railh.css({bottom:"0px"}) : railh.css({top:"0px"});
|
|
|
+ self.body.append(railh);
|
|
|
+ }
|
|
|
+ } else {
|
|
|
+ if (self.ishwscroll) {
|
|
|
+ if (self.win.css('position')=='static') self.css(self.win,{'position':'relative'});
|
|
|
+ var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
|
|
|
+ if (self.zoom) {
|
|
|
+ self.zoom.css({position:"absolute",top:1,right:0,"margin-right":rail.width+4});
|
|
|
+ bd.append(self.zoom);
|
|
|
+ }
|
|
|
+ rail.css({position:"absolute",top:0});
|
|
|
+ (rail.align) ? rail.css({right:0}) : rail.css({left:0});
|
|
|
+ bd.append(rail);
|
|
|
+ if (railh) {
|
|
|
+ railh.css({position:"absolute",left:0,bottom:0});
|
|
|
+ (railh.align) ? railh.css({bottom:0}) : railh.css({top:0});
|
|
|
+ bd.append(railh);
|
|
|
+ }
|
|
|
+ } else {
|
|
|
+ self.isfixed = (self.win.css("position")=="fixed");
|
|
|
+ var rlpos = (self.isfixed) ? "fixed" : "absolute";
|
|
|
+
|
|
|
+ if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
|
|
|
+ if (self.viewport) {
|
|
|
+ self.body = self.viewport;
|
|
|
+ if ((/fixed|relative|absolute/.test(self.viewport.css("position")))==false) self.css(self.viewport,{"position":"relative"});
|
|
|
+ }
|
|
|
+
|
|
|
+ rail.css({position:rlpos});
|
|
|
+ if (self.zoom) self.zoom.css({position:rlpos});
|
|
|
+ self.updateScrollBar();
|
|
|
+ self.body.append(rail);
|
|
|
+ if (self.zoom) self.body.append(self.zoom);
|
|
|
+ if (self.railh) {
|
|
|
+ railh.css({position:rlpos});
|
|
|
+ self.body.append(railh);
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ if (cap.isios) self.css(self.win,{'-webkit-tap-highlight-color':'rgba(0,0,0,0)','-webkit-touch-callout':'none'}); // prevent grey layer on click
|
|
|
+
|
|
|
+ if (cap.isie&&self.opt.disableoutline) self.win.attr("hideFocus","true"); // IE, prevent dotted rectangle on focused div
|
|
|
+ if (cap.iswebkit&&self.opt.disableoutline) self.win.css({"outline":"none"});
|
|
|
+// if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera to test [TODO]
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.opt.autohidemode===false) {
|
|
|
+ self.autohidedom = false;
|
|
|
+ self.rail.css({opacity:self.opt.cursoropacitymax});
|
|
|
+ if (self.railh) self.railh.css({opacity:self.opt.cursoropacitymax});
|
|
|
+ }
|
|
|
+ else if ((self.opt.autohidemode===true)||(self.opt.autohidemode==="leave")) {
|
|
|
+ self.autohidedom = $().add(self.rail);
|
|
|
+ if (cap.isie8) self.autohidedom=self.autohidedom.add(self.cursor);
|
|
|
+ if (self.railh) self.autohidedom=self.autohidedom.add(self.railh);
|
|
|
+ if (self.railh&&cap.isie8) self.autohidedom=self.autohidedom.add(self.cursorh);
|
|
|
+ }
|
|
|
+ else if (self.opt.autohidemode=="scroll") {
|
|
|
+ self.autohidedom = $().add(self.rail);
|
|
|
+ if (self.railh) self.autohidedom=self.autohidedom.add(self.railh);
|
|
|
+ }
|
|
|
+ else if (self.opt.autohidemode=="cursor") {
|
|
|
+ self.autohidedom = $().add(self.cursor);
|
|
|
+ if (self.railh) self.autohidedom=self.autohidedom.add(self.cursorh);
|
|
|
+ }
|
|
|
+ else if (self.opt.autohidemode=="hidden") {
|
|
|
+ self.autohidedom = false;
|
|
|
+ self.hide();
|
|
|
+ self.locked = false;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (cap.isie9mobile) {
|
|
|
+
|
|
|
+ self.scrollmom = new ScrollMomentumClass2D(self);
|
|
|
+
|
|
|
+ /*
|
|
|
+ var trace = function(msg) {
|
|
|
+ var db = $("#debug");
|
|
|
+ if (isNaN(msg)&&(typeof msg != "string")) {
|
|
|
+ var x = [];
|
|
|
+ for(var a in msg) {
|
|
|
+ x.push(a+":"+msg[a]);
|
|
|
+ }
|
|
|
+ msg ="{"+x.join(",")+"}";
|
|
|
+ }
|
|
|
+ if (db.children().length>0) {
|
|
|
+ db.children().eq(0).before("<div>"+msg+"</div>");
|
|
|
+ } else {
|
|
|
+ db.append("<div>"+msg+"</div>");
|
|
|
+ }
|
|
|
+ }
|
|
|
+ window.onerror = function(msg,url,ln) {
|
|
|
+ trace("ERR: "+msg+" at "+ln);
|
|
|
+ }
|
|
|
+*/
|
|
|
+
|
|
|
+ self.onmangotouch = function(e) {
|
|
|
+ var py = self.getScrollTop();
|
|
|
+ var px = self.getScrollLeft();
|
|
|
+
|
|
|
+ if ((py == self.scrollmom.lastscrolly)&&(px == self.scrollmom.lastscrollx)) return true;
|
|
|
+// $("#debug").html('DRAG:'+py);
|
|
|
+
|
|
|
+ var dfy = py-self.mangotouch.sy;
|
|
|
+ var dfx = px-self.mangotouch.sx;
|
|
|
+ var df = Math.round(Math.sqrt(Math.pow(dfx,2)+Math.pow(dfy,2)));
|
|
|
+ if (df==0) return;
|
|
|
+
|
|
|
+ var dry = (dfy<0)?-1:1;
|
|
|
+ var drx = (dfx<0)?-1:1;
|
|
|
+
|
|
|
+ var tm = +new Date();
|
|
|
+ if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
|
|
|
+
|
|
|
+ if (((tm-self.mangotouch.tm)>80)||(self.mangotouch.dry!=dry)||(self.mangotouch.drx!=drx)) {
|
|
|
+// trace('RESET+'+(tm-self.mangotouch.tm));
|
|
|
+ self.scrollmom.stop();
|
|
|
+ self.scrollmom.reset(px,py);
|
|
|
+ self.mangotouch.sy = py;
|
|
|
+ self.mangotouch.ly = py;
|
|
|
+ self.mangotouch.sx = px;
|
|
|
+ self.mangotouch.lx = px;
|
|
|
+ self.mangotouch.dry = dry;
|
|
|
+ self.mangotouch.drx = drx;
|
|
|
+ self.mangotouch.tm = tm;
|
|
|
+ } else {
|
|
|
+
|
|
|
+ self.scrollmom.stop();
|
|
|
+ self.scrollmom.update(self.mangotouch.sx-dfx,self.mangotouch.sy-dfy);
|
|
|
+ var gap = tm - self.mangotouch.tm;
|
|
|
+ self.mangotouch.tm = tm;
|
|
|
+
|
|
|
+// trace('MOVE:'+df+" - "+gap);
|
|
|
+
|
|
|
+ var ds = Math.max(Math.abs(self.mangotouch.ly-py),Math.abs(self.mangotouch.lx-px));
|
|
|
+ self.mangotouch.ly = py;
|
|
|
+ self.mangotouch.lx = px;
|
|
|
+
|
|
|
+ if (ds>2) {
|
|
|
+ self.mangotouch.lazy = setTimeout(function(){
|
|
|
+// trace('END:'+ds+'+'+gap);
|
|
|
+ self.mangotouch.lazy = false;
|
|
|
+ self.mangotouch.dry = 0;
|
|
|
+ self.mangotouch.drx = 0;
|
|
|
+ self.mangotouch.tm = 0;
|
|
|
+ self.scrollmom.doMomentum(30);
|
|
|
+ },100);
|
|
|
+ }
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ var top = self.getScrollTop();
|
|
|
+ var lef = self.getScrollLeft();
|
|
|
+ self.mangotouch = {sy:top,ly:top,dry:0,sx:lef,lx:lef,drx:0,lazy:false,tm:0};
|
|
|
+
|
|
|
+ self.bind(self.docscroll,"scroll",self.onmangotouch);
|
|
|
+
|
|
|
+ } else {
|
|
|
+
|
|
|
+ if (cap.cantouch||self.istouchcapable||self.opt.touchbehavior||cap.hasmstouch) {
|
|
|
+
|
|
|
+ self.scrollmom = new ScrollMomentumClass2D(self);
|
|
|
+
|
|
|
+ self.ontouchstart = function(e) {
|
|
|
+ if (e.pointerType&&e.pointerType!=2) return false;
|
|
|
+
|
|
|
+ self.hasmoving = false;
|
|
|
+
|
|
|
+ if (!self.locked) {
|
|
|
+
|
|
|
+ if (cap.hasmstouch) {
|
|
|
+ var tg = (e.target) ? e.target : false;
|
|
|
+ while (tg) {
|
|
|
+ var nc = $(tg).getNiceScroll();
|
|
|
+ if ((nc.length>0)&&(nc[0].me == self.me)) break;
|
|
|
+ if (nc.length>0) return false;
|
|
|
+ if ((tg.nodeName=='DIV')&&(tg.id==self.id)) break;
|
|
|
+ tg = (tg.parentNode) ? tg.parentNode : false;
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ self.cancelScroll();
|
|
|
+
|
|
|
+ var tg = self.getTarget(e);
|
|
|
+
|
|
|
+ if (tg) {
|
|
|
+ var skp = (/INPUT/i.test(tg.nodeName))&&(/range/i.test(tg.type));
|
|
|
+ if (skp) return self.stopPropagation(e);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!("clientX" in e) && ("changedTouches" in e)) {
|
|
|
+ e.clientX = e.changedTouches[0].clientX;
|
|
|
+ e.clientY = e.changedTouches[0].clientY;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.forcescreen) {
|
|
|
+ var le = e;
|
|
|
+ var e = {"original":(e.original)?e.original:e};
|
|
|
+ e.clientX = le.screenX;
|
|
|
+ e.clientY = le.screenY;
|
|
|
+ }
|
|
|
+
|
|
|
+ self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,st:self.getScrollTop(),sl:self.getScrollLeft(),pt:2,dl:false};
|
|
|
+
|
|
|
+ if (self.ispage||!self.opt.directionlockdeadzone) {
|
|
|
+ self.rail.drag.dl = "f";
|
|
|
+ } else {
|
|
|
+
|
|
|
+ var view = {
|
|
|
+ w:$(window).width(),
|
|
|
+ h:$(window).height()
|
|
|
+ };
|
|
|
+
|
|
|
+ var page = {
|
|
|
+ w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth),
|
|
|
+ h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)
|
|
|
+ }
|
|
|
+
|
|
|
+ var maxh = Math.max(0,page.h - view.h);
|
|
|
+ var maxw = Math.max(0,page.w - view.w);
|
|
|
+
|
|
|
+ if (!self.rail.scrollable&&self.railh.scrollable) self.rail.drag.ck = (maxh>0) ? "v" : false;
|
|
|
+ else if (self.rail.scrollable&&!self.railh.scrollable) self.rail.drag.ck = (maxw>0) ? "h" : false;
|
|
|
+ else self.rail.drag.ck = false;
|
|
|
+ if (!self.rail.drag.ck) self.rail.drag.dl = "f";
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.opt.touchbehavior&&self.isiframe&&cap.isie) {
|
|
|
+ var wp = self.win.position();
|
|
|
+ self.rail.drag.x+=wp.left;
|
|
|
+ self.rail.drag.y+=wp.top;
|
|
|
+ }
|
|
|
+
|
|
|
+ self.hasmoving = false;
|
|
|
+ self.lastmouseup = false;
|
|
|
+ self.scrollmom.reset(e.clientX,e.clientY);
|
|
|
+ if (!cap.cantouch&&!this.istouchcapable&&!cap.hasmstouch) {
|
|
|
+
|
|
|
+ var ip = (tg)?/INPUT|SELECT|TEXTAREA/i.test(tg.nodeName):false;
|
|
|
+ if (!ip) {
|
|
|
+ if (!self.ispage&&cap.hasmousecapture) tg.setCapture();
|
|
|
+
|
|
|
+ if (self.opt.touchbehavior) {
|
|
|
+ if (tg.onclick&&!(tg._onclick||false)) { // intercept DOM0 onclick event
|
|
|
+// console.log('pre.click');
|
|
|
+ tg._onclick = tg.onclick;
|
|
|
+ tg.onclick = function(e){
|
|
|
+ var df = (+new Date()) - self.scrollmom.lasttime;
|
|
|
+// console.log('click:'+df);
|
|
|
+ if (self.hasmoving) return false;
|
|
|
+ tg._onclick.call(this,e);
|
|
|
+ }
|
|
|
+ }
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ }
|
|
|
+
|
|
|
+ return self.stopPropagation(e);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
|
|
|
+ pc = {"tg":tg,"click":false};
|
|
|
+ self.preventclick = pc;
|
|
|
+ }
|
|
|
+
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+ self.ontouchend = function(e) {
|
|
|
+ if (e.pointerType&&e.pointerType!=2) return false;
|
|
|
+ if (self.rail.drag&&(self.rail.drag.pt==2)) {
|
|
|
+ self.scrollmom.doMomentum();
|
|
|
+ self.rail.drag = false;
|
|
|
+ if (self.hasmoving) {
|
|
|
+ self.lastmouseup = true;
|
|
|
+ self.hideCursor();
|
|
|
+ if (cap.hasmousecapture) document.releaseCapture();
|
|
|
+ if (!cap.cantouch) return self.cancelEvent(e);
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+ var moveneedoffset = (self.opt.touchbehavior&&self.isiframe&&!cap.hasmousecapture);
|
|
|
+
|
|
|
+ self.ontouchmove = function(e,byiframe) {
|
|
|
+
|
|
|
+ if (e.pointerType&&e.pointerType!=2) return false;
|
|
|
+
|
|
|
+ if (self.rail.drag&&(self.rail.drag.pt==2)) {
|
|
|
+ if (cap.cantouch&&(typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements
|
|
|
+
|
|
|
+ self.hasmoving = true;
|
|
|
+
|
|
|
+ if (self.preventclick&&!self.preventclick.click) {
|
|
|
+ self.preventclick.click = self.preventclick.tg.onclick||false;
|
|
|
+ self.preventclick.tg.onclick = self.onpreventclick;
|
|
|
+ }
|
|
|
+
|
|
|
+ var ev = $.extend({"original":e},e);
|
|
|
+ e = ev;
|
|
|
+
|
|
|
+ if (("changedTouches" in e)) {
|
|
|
+ e.clientX = e.changedTouches[0].clientX;
|
|
|
+ e.clientY = e.changedTouches[0].clientY;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.forcescreen) {
|
|
|
+ var le = e;
|
|
|
+ var e = {"original":(e.original)?e.original:e};
|
|
|
+ e.clientX = le.screenX;
|
|
|
+ e.clientY = le.screenY;
|
|
|
+ }
|
|
|
+
|
|
|
+ var ofx = ofy = 0;
|
|
|
+
|
|
|
+ if (moveneedoffset&&!byiframe) {
|
|
|
+ var wp = self.win.position();
|
|
|
+ ofx=-wp.left;
|
|
|
+ ofy=-wp.top;
|
|
|
+ }
|
|
|
+
|
|
|
+ var fy = e.clientY + ofy;
|
|
|
+ var my = (fy-self.rail.drag.y);
|
|
|
+ var fx = e.clientX + ofx;
|
|
|
+ var mx = (fx-self.rail.drag.x);
|
|
|
+
|
|
|
+ var ny = self.rail.drag.st-my;
|
|
|
+
|
|
|
+ if (self.ishwscroll&&self.opt.bouncescroll) {
|
|
|
+ if (ny<0) {
|
|
|
+ ny = Math.round(ny/2);
|
|
|
+// fy = 0;
|
|
|
+ }
|
|
|
+ else if (ny>self.page.maxh) {
|
|
|
+ ny = self.page.maxh+Math.round((ny-self.page.maxh)/2);
|
|
|
+// fy = 0;
|
|
|
+ }
|
|
|
+ } else {
|
|
|
+ if (ny<0) {ny=0;fy=0}
|
|
|
+ if (ny>self.page.maxh) {ny=self.page.maxh;fy=0}
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.railh&&self.railh.scrollable) {
|
|
|
+ var nx = self.rail.drag.sl-mx;
|
|
|
+
|
|
|
+ if (self.ishwscroll&&self.opt.bouncescroll) {
|
|
|
+ if (nx<0) {
|
|
|
+ nx = Math.round(nx/2);
|
|
|
+// fx = 0;
|
|
|
+ }
|
|
|
+ else if (nx>self.page.maxw) {
|
|
|
+ nx = self.page.maxw+Math.round((nx-self.page.maxw)/2);
|
|
|
+// fx = 0;
|
|
|
+ }
|
|
|
+ } else {
|
|
|
+ if (nx<0) {nx=0;fx=0}
|
|
|
+ if (nx>self.page.maxw) {nx=self.page.maxw;fx=0}
|
|
|
+ }
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ var grabbed = false;
|
|
|
+ if (self.rail.drag.dl) {
|
|
|
+ grabbed = true;
|
|
|
+ if (self.rail.drag.dl=="v") nx = self.rail.drag.sl;
|
|
|
+ else if (self.rail.drag.dl=="h") ny = self.rail.drag.st;
|
|
|
+ } else {
|
|
|
+ var ay = Math.abs(my);
|
|
|
+ var ax = Math.abs(mx);
|
|
|
+ var dz = self.opt.directionlockdeadzone;
|
|
|
+ if (self.rail.drag.ck=="v") {
|
|
|
+ if (ay>dz&&(ax<=(ay*0.3))) {
|
|
|
+ self.rail.drag = false;
|
|
|
+ return true;
|
|
|
+ }
|
|
|
+ else if (ax>dz) {
|
|
|
+ self.rail.drag.dl="f";
|
|
|
+ $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
|
|
|
+ }
|
|
|
+ }
|
|
|
+ else if (self.rail.drag.ck=="h") {
|
|
|
+ if (ax>dz&&(ay<=(ax*0.3))) {
|
|
|
+ self.rail.drag = false;
|
|
|
+ return true;
|
|
|
+ }
|
|
|
+ else if (ay>dz) {
|
|
|
+ self.rail.drag.dl="f";
|
|
|
+ $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
|
|
|
+ }
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ self.synched("touchmove",function(){
|
|
|
+ if (self.rail.drag&&(self.rail.drag.pt==2)) {
|
|
|
+ if (self.prepareTransition) self.prepareTransition(0);
|
|
|
+ if (self.rail.scrollable) self.setScrollTop(ny);
|
|
|
+ self.scrollmom.update(fx,fy);
|
|
|
+ if (self.railh&&self.railh.scrollable) {
|
|
|
+ self.setScrollLeft(nx);
|
|
|
+ self.showCursor(ny,nx);
|
|
|
+ } else {
|
|
|
+ self.showCursor(ny);
|
|
|
+ }
|
|
|
+ if (cap.isie10) document.selection.clear();
|
|
|
+ }
|
|
|
+ });
|
|
|
+
|
|
|
+ if (cap.ischrome&&self.istouchcapable) grabbed=false; //chrome touch emulation doesn't like!
|
|
|
+ if (grabbed) return self.cancelEvent(e);
|
|
|
+ }
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ self.onmousedown = function(e,hronly) {
|
|
|
+ if (self.rail.drag&&self.rail.drag.pt!=1) return;
|
|
|
+ if (self.locked) return self.cancelEvent(e);
|
|
|
+ self.cancelScroll();
|
|
|
+ self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,pt:1,hr:(!!hronly)};
|
|
|
+ var tg = self.getTarget(e);
|
|
|
+ if (!self.ispage&&cap.hasmousecapture) tg.setCapture();
|
|
|
+ if (self.isiframe&&!cap.hasmousecapture) {
|
|
|
+ self.saved["csspointerevents"] = self.doc.css("pointer-events");
|
|
|
+ self.css(self.doc,{"pointer-events":"none"});
|
|
|
+ }
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ };
|
|
|
+
|
|
|
+ self.onmouseup = function(e) {
|
|
|
+ if (self.rail.drag) {
|
|
|
+ if (cap.hasmousecapture) document.releaseCapture();
|
|
|
+ if (self.isiframe&&!cap.hasmousecapture) self.doc.css("pointer-events",self.saved["csspointerevents"]);
|
|
|
+ if(self.rail.drag.pt!=1)return;
|
|
|
+ self.rail.drag = false;
|
|
|
+ //if (!self.rail.active) self.hideCursor();
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ self.onmousemove = function(e) {
|
|
|
+ if (self.rail.drag) {
|
|
|
+ if(self.rail.drag.pt!=1)return;
|
|
|
+
|
|
|
+ if (cap.ischrome&&e.which==0) return self.onmouseup(e);
|
|
|
+
|
|
|
+ self.cursorfreezed = true;
|
|
|
+
|
|
|
+ if (self.rail.drag.hr) {
|
|
|
+ self.scroll.x = self.rail.drag.sx + (e.clientX-self.rail.drag.x);
|
|
|
+ if (self.scroll.x<0) self.scroll.x=0;
|
|
|
+ var mw = self.scrollvaluemaxw;
|
|
|
+ if (self.scroll.x>mw) self.scroll.x=mw;
|
|
|
+ } else {
|
|
|
+ self.scroll.y = self.rail.drag.sy + (e.clientY-self.rail.drag.y);
|
|
|
+ if (self.scroll.y<0) self.scroll.y=0;
|
|
|
+ var my = self.scrollvaluemax;
|
|
|
+ if (self.scroll.y>my) self.scroll.y=my;
|
|
|
+ }
|
|
|
+
|
|
|
+ self.synched('mousemove',function(){
|
|
|
+ if (self.rail.drag&&(self.rail.drag.pt==1)) {
|
|
|
+ self.showCursor();
|
|
|
+ if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x*self.scrollratio.x),self.opt.cursordragspeed);
|
|
|
+ else self.doScrollTop(Math.round(self.scroll.y*self.scrollratio.y),self.opt.cursordragspeed);
|
|
|
+ }
|
|
|
+ });
|
|
|
+
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ }
|
|
|
+/*
|
|
|
+ else {
|
|
|
+ self.checkarea = true;
|
|
|
+ }
|
|
|
+*/
|
|
|
+ };
|
|
|
+
|
|
|
+ if (cap.cantouch||self.opt.touchbehavior) {
|
|
|
+
|
|
|
+ self.onpreventclick = function(e) {
|
|
|
+ if (self.preventclick) {
|
|
|
+ self.preventclick.tg.onclick = self.preventclick.click;
|
|
|
+ self.preventclick = false;
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+// self.onmousedown = self.ontouchstart;
|
|
|
+// self.onmouseup = self.ontouchend;
|
|
|
+// self.onmousemove = self.ontouchmove;
|
|
|
+
|
|
|
+ self.bind(self.win,"mousedown",self.ontouchstart); // control content dragging
|
|
|
+
|
|
|
+ self.onclick = (cap.isios) ? false : function(e) {
|
|
|
+ if (self.lastmouseup) {
|
|
|
+ self.lastmouseup = false;
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ } else {
|
|
|
+ return true;
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) {
|
|
|
+ self.css((self.ispage)?self.doc:self.win,{'cursor':cap.cursorgrabvalue});
|
|
|
+ self.css(self.rail,{'cursor':cap.cursorgrabvalue});
|
|
|
+ }
|
|
|
+
|
|
|
+ } else {
|
|
|
+
|
|
|
+ function checkSelectionScroll(e) {
|
|
|
+ if (!self.selectiondrag) return;
|
|
|
+
|
|
|
+ if (e) {
|
|
|
+ var ww = self.win.outerHeight();
|
|
|
+ var df = (e.pageY - self.selectiondrag.top);
|
|
|
+ if (df>0&&df<ww) df=0;
|
|
|
+ if (df>=ww) df-=ww;
|
|
|
+ self.selectiondrag.df = df;
|
|
|
+ }
|
|
|
+ if (self.selectiondrag.df==0) return;
|
|
|
+
|
|
|
+ var rt = -Math.floor(self.selectiondrag.df/6)*2;
|
|
|
+// self.doScrollTop(self.getScrollTop(true)+rt);
|
|
|
+ self.doScrollBy(rt);
|
|
|
+
|
|
|
+ self.debounced("doselectionscroll",function(){checkSelectionScroll()},50);
|
|
|
+ }
|
|
|
+
|
|
|
+ if ("getSelection" in document) { // A grade - Major browsers
|
|
|
+ self.hasTextSelected = function() {
|
|
|
+ return (document.getSelection().rangeCount>0);
|
|
|
+ }
|
|
|
+ }
|
|
|
+ else if ("selection" in document) { //IE9-
|
|
|
+ self.hasTextSelected = function() {
|
|
|
+ return (document.selection.type != "None");
|
|
|
+ }
|
|
|
+ }
|
|
|
+ else {
|
|
|
+ self.hasTextSelected = function() { // no support
|
|
|
+ return false;
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ self.onselectionstart = function(e) {
|
|
|
+ if (self.ispage) return;
|
|
|
+ self.selectiondrag = self.win.offset();
|
|
|
+ }
|
|
|
+ self.onselectionend = function(e) {
|
|
|
+ self.selectiondrag = false;
|
|
|
+ }
|
|
|
+ self.onselectiondrag = function(e) {
|
|
|
+ if (!self.selectiondrag) return;
|
|
|
+ if (self.hasTextSelected()) self.debounced("selectionscroll",function(){checkSelectionScroll(e)},250);
|
|
|
+ }
|
|
|
+
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ if (cap.hasmstouch) {
|
|
|
+ self.css(self.rail,{'-ms-touch-action':'none'});
|
|
|
+ self.css(self.cursor,{'-ms-touch-action':'none'});
|
|
|
+
|
|
|
+ self.bind(self.win,"MSPointerDown",self.ontouchstart);
|
|
|
+ self.bind(document,"MSPointerUp",self.ontouchend);
|
|
|
+ self.bind(document,"MSPointerMove",self.ontouchmove);
|
|
|
+ self.bind(self.cursor,"MSGestureHold",function(e){e.preventDefault()});
|
|
|
+ self.bind(self.cursor,"contextmenu",function(e){e.preventDefault()});
|
|
|
+ }
|
|
|
+
|
|
|
+ if (this.istouchcapable) { //desktop with screen touch enabled
|
|
|
+ self.bind(self.win,"touchstart",self.ontouchstart);
|
|
|
+ self.bind(document,"touchend",self.ontouchend);
|
|
|
+ self.bind(document,"touchcancel",self.ontouchend);
|
|
|
+ self.bind(document,"touchmove",self.ontouchmove);
|
|
|
+ }
|
|
|
+
|
|
|
+ self.bind(self.cursor,"mousedown",self.onmousedown);
|
|
|
+ self.bind(self.cursor,"mouseup",self.onmouseup);
|
|
|
+
|
|
|
+ if (self.railh) {
|
|
|
+ self.bind(self.cursorh,"mousedown",function(e){self.onmousedown(e,true)});
|
|
|
+ self.bind(self.cursorh,"mouseup",function(e){
|
|
|
+ if (self.rail.drag&&self.rail.drag.pt==2) return;
|
|
|
+ self.rail.drag = false;
|
|
|
+ self.hasmoving = false;
|
|
|
+ self.hideCursor();
|
|
|
+ if (cap.hasmousecapture) document.releaseCapture();
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ });
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.opt.cursordragontouch||!cap.cantouch&&!self.opt.touchbehavior) {
|
|
|
+
|
|
|
+ self.rail.css({"cursor":"default"});
|
|
|
+ self.railh&&self.railh.css({"cursor":"default"});
|
|
|
+
|
|
|
+ self.jqbind(self.rail,"mouseenter",function() {
|
|
|
+ if (self.canshowonmouseevent) self.showCursor();
|
|
|
+ self.rail.active = true;
|
|
|
+ });
|
|
|
+ self.jqbind(self.rail,"mouseleave",function() {
|
|
|
+ self.rail.active = false;
|
|
|
+ if (!self.rail.drag) self.hideCursor();
|
|
|
+ });
|
|
|
+
|
|
|
+ if (self.opt.sensitiverail) {
|
|
|
+ self.bind(self.rail,"click",function(e){self.doRailClick(e,false,false)});
|
|
|
+ self.bind(self.rail,"dblclick",function(e){self.doRailClick(e,true,false)});
|
|
|
+ self.bind(self.cursor,"click",function(e){self.cancelEvent(e)});
|
|
|
+ self.bind(self.cursor,"dblclick",function(e){self.cancelEvent(e)});
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.railh) {
|
|
|
+ self.jqbind(self.railh,"mouseenter",function() {
|
|
|
+ if (self.canshowonmouseevent) self.showCursor();
|
|
|
+ self.rail.active = true;
|
|
|
+ });
|
|
|
+ self.jqbind(self.railh,"mouseleave",function() {
|
|
|
+ self.rail.active = false;
|
|
|
+ if (!self.rail.drag) self.hideCursor();
|
|
|
+ });
|
|
|
+
|
|
|
+ if (self.opt.sensitiverail) {
|
|
|
+ self.bind(self.railh, "click", function(e){self.doRailClick(e,false,true)});
|
|
|
+ self.bind(self.railh, "dblclick", function(e){self.doRailClick(e, true, true) });
|
|
|
+ self.bind(self.cursorh, "click", function (e) { self.cancelEvent(e) });
|
|
|
+ self.bind(self.cursorh, "dblclick", function (e) { self.cancelEvent(e) });
|
|
|
+ }
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!cap.cantouch&&!self.opt.touchbehavior) {
|
|
|
+
|
|
|
+ self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.onmouseup);
|
|
|
+ self.bind(document,"mousemove",self.onmousemove);
|
|
|
+ if (self.onclick) self.bind(document,"click",self.onclick);
|
|
|
+
|
|
|
+ if (!self.ispage&&self.opt.enablescrollonselection) {
|
|
|
+ self.bind(self.win[0],"mousedown",self.onselectionstart);
|
|
|
+ self.bind(document,"mouseup",self.onselectionend);
|
|
|
+ self.bind(self.cursor,"mouseup",self.onselectionend);
|
|
|
+ if (self.cursorh) self.bind(self.cursorh,"mouseup",self.onselectionend);
|
|
|
+ self.bind(document,"mousemove",self.onselectiondrag);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.zoom) {
|
|
|
+ self.jqbind(self.zoom,"mouseenter",function() {
|
|
|
+ if (self.canshowonmouseevent) self.showCursor();
|
|
|
+ self.rail.active = true;
|
|
|
+ });
|
|
|
+ self.jqbind(self.zoom,"mouseleave",function() {
|
|
|
+ self.rail.active = false;
|
|
|
+ if (!self.rail.drag) self.hideCursor();
|
|
|
+ });
|
|
|
+ }
|
|
|
+
|
|
|
+ } else {
|
|
|
+
|
|
|
+ self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.ontouchend);
|
|
|
+ self.bind(document,"mousemove",self.ontouchmove);
|
|
|
+ if (self.onclick) self.bind(document,"click",self.onclick);
|
|
|
+
|
|
|
+ if (self.opt.cursordragontouch) {
|
|
|
+ self.bind(self.cursor,"mousedown",self.onmousedown);
|
|
|
+ self.bind(self.cursor,"mousemove",self.onmousemove);
|
|
|
+ self.cursorh&&self.bind(self.cursorh,"mousedown",function(e){self.onmousedown(e,true)});
|
|
|
+ self.cursorh&&self.bind(self.cursorh,"mousemove",self.onmousemove);
|
|
|
+ }
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.opt.enablemousewheel) {
|
|
|
+ if (!self.isiframe) self.bind((cap.isie&&self.ispage) ? document : self.win /*self.docscroll*/ ,"mousewheel",self.onmousewheel);
|
|
|
+ self.bind(self.rail,"mousewheel",self.onmousewheel);
|
|
|
+ if (self.railh) self.bind(self.railh,"mousewheel",self.onmousewheelhr);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!self.ispage&&!cap.cantouch&&!(/HTML|BODY/.test(self.win[0].nodeName))) {
|
|
|
+ if (!self.win.attr("tabindex")) self.win.attr({"tabindex":tabindexcounter++});
|
|
|
+
|
|
|
+ self.jqbind(self.win,"focus",function(e) {
|
|
|
+ domfocus = (self.getTarget(e)).id||true;
|
|
|
+ self.hasfocus = true;
|
|
|
+ if (self.canshowonmouseevent) self.noticeCursor();
|
|
|
+ });
|
|
|
+ self.jqbind(self.win,"blur",function(e) {
|
|
|
+ domfocus = false;
|
|
|
+ self.hasfocus = false;
|
|
|
+ });
|
|
|
+
|
|
|
+ self.jqbind(self.win,"mouseenter",function(e) {
|
|
|
+ mousefocus = (self.getTarget(e)).id||true;
|
|
|
+ self.hasmousefocus = true;
|
|
|
+ if (self.canshowonmouseevent) self.noticeCursor();
|
|
|
+ });
|
|
|
+ self.jqbind(self.win,"mouseleave",function() {
|
|
|
+ mousefocus = false;
|
|
|
+ self.hasmousefocus = false;
|
|
|
+ if (!self.rail.drag) self.hideCursor();
|
|
|
+ });
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+ } // !ie9mobile
|
|
|
+
|
|
|
+ //Thanks to http://www.quirksmode.org !!
|
|
|
+ self.onkeypress = function(e) {
|
|
|
+ if (self.locked&&self.page.maxh==0) return true;
|
|
|
+
|
|
|
+ e = (e) ? e : window.e;
|
|
|
+ var tg = self.getTarget(e);
|
|
|
+ if (tg&&/INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
|
|
|
+ var tp = tg.getAttribute('type')||tg.type||false;
|
|
|
+ if ((!tp)||!(/submit|button|cancel/i.tp)) return true;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.hasfocus||(self.hasmousefocus&&!domfocus)||(self.ispage&&!domfocus&&!mousefocus)) {
|
|
|
+ var key = e.keyCode;
|
|
|
+
|
|
|
+ if (self.locked&&key!=27) return self.cancelEvent(e);
|
|
|
+
|
|
|
+ var ctrl = e.ctrlKey||false;
|
|
|
+ var shift = e.shiftKey || false;
|
|
|
+
|
|
|
+ var ret = false;
|
|
|
+ switch (key) {
|
|
|
+ case 38:
|
|
|
+ case 63233: //safari
|
|
|
+ self.doScrollBy(24*3);
|
|
|
+ ret = true;
|
|
|
+ break;
|
|
|
+ case 40:
|
|
|
+ case 63235: //safari
|
|
|
+ self.doScrollBy(-24*3);
|
|
|
+ ret = true;
|
|
|
+ break;
|
|
|
+ case 37:
|
|
|
+ case 63232: //safari
|
|
|
+ if (self.railh) {
|
|
|
+ (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24*3);
|
|
|
+ ret = true;
|
|
|
+ }
|
|
|
+ break;
|
|
|
+ case 39:
|
|
|
+ case 63234: //safari
|
|
|
+ if (self.railh) {
|
|
|
+ (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24*3);
|
|
|
+ ret = true;
|
|
|
+ }
|
|
|
+ break;
|
|
|
+ case 33:
|
|
|
+ case 63276: // safari
|
|
|
+ self.doScrollBy(self.view.h);
|
|
|
+ ret = true;
|
|
|
+ break;
|
|
|
+ case 34:
|
|
|
+ case 63277: // safari
|
|
|
+ self.doScrollBy(-self.view.h);
|
|
|
+ ret = true;
|
|
|
+ break;
|
|
|
+ case 36:
|
|
|
+ case 63273: // safari
|
|
|
+ (self.railh&&ctrl) ? self.doScrollPos(0,0) : self.doScrollTo(0);
|
|
|
+ ret = true;
|
|
|
+ break;
|
|
|
+ case 35:
|
|
|
+ case 63275: // safari
|
|
|
+ (self.railh&&ctrl) ? self.doScrollPos(self.page.maxw,self.page.maxh) : self.doScrollTo(self.page.maxh);
|
|
|
+ ret = true;
|
|
|
+ break;
|
|
|
+ case 32:
|
|
|
+ if (self.opt.spacebarenabled) {
|
|
|
+ (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h);
|
|
|
+ ret = true;
|
|
|
+ }
|
|
|
+ break;
|
|
|
+ case 27: // ESC
|
|
|
+ if (self.zoomactive) {
|
|
|
+ self.doZoom();
|
|
|
+ ret = true;
|
|
|
+ }
|
|
|
+ break;
|
|
|
+ }
|
|
|
+ if (ret) return self.cancelEvent(e);
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ if (self.opt.enablekeyboard) self.bind(document,(cap.isopera&&!cap.isopera12)?"keypress":"keydown",self.onkeypress);
|
|
|
+
|
|
|
+ self.bind(window,'resize',self.lazyResize);
|
|
|
+ self.bind(window,'orientationchange',self.lazyResize);
|
|
|
+
|
|
|
+ self.bind(window,"load",self.lazyResize);
|
|
|
+
|
|
|
+ if (cap.ischrome&&!self.ispage&&!self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
|
|
|
+ var tmp=self.win.attr("style");
|
|
|
+ var ww = parseFloat(self.win.css("width"))+1;
|
|
|
+ self.win.css('width',ww);
|
|
|
+ self.synched("chromefix",function(){self.win.attr("style",tmp)});
|
|
|
+ }
|
|
|
+
|
|
|
+
|
|
|
+// Trying a cross-browser implementation - good luck!
|
|
|
+
|
|
|
+ self.onAttributeChange = function(e) {
|
|
|
+ self.lazyResize(250);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!self.ispage&&!self.haswrapper) {
|
|
|
+ // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
|
|
|
+ if (clsMutationObserver !== false) {
|
|
|
+ self.observer = new clsMutationObserver(function(mutations) {
|
|
|
+ mutations.forEach(self.onAttributeChange);
|
|
|
+ });
|
|
|
+ self.observer.observe(self.win[0],{childList: true, characterData: false, attributes: true, subtree: false});
|
|
|
+
|
|
|
+ self.observerremover = new clsMutationObserver(function(mutations) {
|
|
|
+ mutations.forEach(function(mo){
|
|
|
+ if (mo.removedNodes.length>0) {
|
|
|
+ for (var dd in mo.removedNodes) {
|
|
|
+ if (mo.removedNodes[dd]==self.win[0]) return self.remove();
|
|
|
+ }
|
|
|
+ }
|
|
|
+ });
|
|
|
+ });
|
|
|
+ self.observerremover.observe(self.win[0].parentNode,{childList: true, characterData: false, attributes: false, subtree: false});
|
|
|
+
|
|
|
+ } else {
|
|
|
+ self.bind(self.win,(cap.isie&&!cap.isie9)?"propertychange":"DOMAttrModified",self.onAttributeChange);
|
|
|
+ if (cap.isie9) self.win[0].attachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug
|
|
|
+ self.bind(self.win,"DOMNodeRemoved",function(e){
|
|
|
+ if (e.target==self.win[0]) self.remove();
|
|
|
+ });
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+//
|
|
|
+
|
|
|
+ if (!self.ispage&&self.opt.boxzoom) self.bind(window,"resize",self.resizeZoom);
|
|
|
+ if (self.istextarea) self.bind(self.win,"mouseup",self.lazyResize);
|
|
|
+
|
|
|
+ self.checkrtlmode = true;
|
|
|
+ self.lazyResize(30);
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ if (this.doc[0].nodeName == 'IFRAME') {
|
|
|
+ function oniframeload(e) {
|
|
|
+ self.iframexd = false;
|
|
|
+ try {
|
|
|
+ var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
|
|
|
+ var a = doc.domain;
|
|
|
+ } catch(e){self.iframexd = true;doc=false};
|
|
|
+
|
|
|
+ if (self.iframexd) {
|
|
|
+ if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
|
|
|
+ return true; //cross-domain - I can't manage this
|
|
|
+ }
|
|
|
+
|
|
|
+ self.forcescreen = true;
|
|
|
+
|
|
|
+ if (self.isiframe) {
|
|
|
+ self.iframe = {
|
|
|
+ "doc":$(doc),
|
|
|
+ "html":self.doc.contents().find('html')[0],
|
|
|
+ "body":self.doc.contents().find('body')[0]
|
|
|
+ };
|
|
|
+ self.getContentSize = function(){
|
|
|
+ return {
|
|
|
+ w:Math.max(self.iframe.html.scrollWidth,self.iframe.body.scrollWidth),
|
|
|
+ h:Math.max(self.iframe.html.scrollHeight,self.iframe.body.scrollHeight)
|
|
|
+ }
|
|
|
+ }
|
|
|
+ self.docscroll = $(self.iframe.body);//$(this.contentWindow);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!cap.isios&&self.opt.iframeautoresize&&!self.isiframe) {
|
|
|
+ self.win.scrollTop(0); // reset position
|
|
|
+ self.doc.height(""); //reset height to fix browser bug
|
|
|
+ var hh=Math.max(doc.getElementsByTagName('html')[0].scrollHeight,doc.body.scrollHeight);
|
|
|
+ self.doc.height(hh);
|
|
|
+ }
|
|
|
+ self.lazyResize(30);
|
|
|
+
|
|
|
+ if (cap.isie7) self.css($(self.iframe.html),{'overflow-y':'hidden'});
|
|
|
+ //self.css($(doc.body),{'overflow-y':'hidden'});
|
|
|
+ self.css($(self.iframe.body),{'overflow-y':'hidden'});
|
|
|
+
|
|
|
+ if (cap.isios&&self.haswrapper) {
|
|
|
+ self.css($(doc.body),{'-webkit-transform':'translate3d(0,0,0)'}); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
|
|
|
+ }
|
|
|
+
|
|
|
+ if ('contentWindow' in this) {
|
|
|
+ self.bind(this.contentWindow,"scroll",self.onscroll); //IE8 & minor
|
|
|
+ } else {
|
|
|
+ self.bind(doc,"scroll",self.onscroll);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.opt.enablemousewheel) {
|
|
|
+ self.bind(doc,"mousewheel",self.onmousewheel);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.opt.enablekeyboard) self.bind(doc,(cap.isopera)?"keypress":"keydown",self.onkeypress);
|
|
|
+
|
|
|
+ if (cap.cantouch||self.opt.touchbehavior) {
|
|
|
+ self.bind(doc,"mousedown",self.ontouchstart);
|
|
|
+ self.bind(doc,"mousemove",function(e){self.ontouchmove(e,true)});
|
|
|
+ if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) self.css($(doc.body),{'cursor':cap.cursorgrabvalue});
|
|
|
+ }
|
|
|
+
|
|
|
+ self.bind(doc,"mouseup",self.ontouchend);
|
|
|
+
|
|
|
+ if (self.zoom) {
|
|
|
+ if (self.opt.dblclickzoom) self.bind(doc,'dblclick',self.doZoom);
|
|
|
+ if (self.ongesturezoom) self.bind(doc,"gestureend",self.ongesturezoom);
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ if (this.doc[0].readyState&&this.doc[0].readyState=="complete"){
|
|
|
+ setTimeout(function(){oniframeload.call(self.doc[0],false)},500);
|
|
|
+ }
|
|
|
+ self.bind(this.doc,"load",oniframeload);
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+ this.showCursor = function(py,px) {
|
|
|
+ if (self.cursortimeout) {
|
|
|
+ clearTimeout(self.cursortimeout);
|
|
|
+ self.cursortimeout = 0;
|
|
|
+ }
|
|
|
+ if (!self.rail) return;
|
|
|
+ if (self.autohidedom) {
|
|
|
+ self.autohidedom.stop().css({opacity:self.opt.cursoropacitymax});
|
|
|
+ self.cursoractive = true;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!self.rail.drag||self.rail.drag.pt!=1) {
|
|
|
+ if ((typeof py != "undefined")&&(py!==false)) {
|
|
|
+ self.scroll.y = Math.round(py * 1/self.scrollratio.y);
|
|
|
+ }
|
|
|
+ if (typeof px != "undefined") {
|
|
|
+ self.scroll.x = Math.round(px * 1/self.scrollratio.x);
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ self.cursor.css({height:self.cursorheight,top:self.scroll.y});
|
|
|
+ if (self.cursorh) {
|
|
|
+ (!self.rail.align&&self.rail.visibility) ? self.cursorh.css({width:self.cursorwidth,left:self.scroll.x+self.rail.width}) : self.cursorh.css({width:self.cursorwidth,left:self.scroll.x});
|
|
|
+ self.cursoractive = true;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.zoom) self.zoom.stop().css({opacity:self.opt.cursoropacitymax});
|
|
|
+ };
|
|
|
+
|
|
|
+ this.hideCursor = function(tm) {
|
|
|
+ if (self.cursortimeout) return;
|
|
|
+ if (!self.rail) return;
|
|
|
+ if (!self.autohidedom) return;
|
|
|
+ if (self.hasmousefocus&&self.opt.autohidemode=="leave") return;
|
|
|
+ self.cursortimeout = setTimeout(function() {
|
|
|
+ if (!self.rail.active||!self.showonmouseevent) {
|
|
|
+ self.autohidedom.stop().animate({opacity:self.opt.cursoropacitymin});
|
|
|
+ if (self.zoom) self.zoom.stop().animate({opacity:self.opt.cursoropacitymin});
|
|
|
+ self.cursoractive = false;
|
|
|
+ }
|
|
|
+ self.cursortimeout = 0;
|
|
|
+ },tm||self.opt.hidecursordelay);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.noticeCursor = function(tm,py,px) {
|
|
|
+ self.showCursor(py,px);
|
|
|
+ if (!self.rail.active) self.hideCursor(tm);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.getContentSize =
|
|
|
+ (self.ispage) ?
|
|
|
+ function(){
|
|
|
+ return {
|
|
|
+ w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth),
|
|
|
+ h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)
|
|
|
+ }
|
|
|
+ }
|
|
|
+ : (self.haswrapper) ?
|
|
|
+ function(){
|
|
|
+ return {
|
|
|
+ w:self.doc.outerWidth()+parseInt(self.win.css('paddingLeft'))+parseInt(self.win.css('paddingRight')),
|
|
|
+ h:self.doc.outerHeight()+parseInt(self.win.css('paddingTop'))+parseInt(self.win.css('paddingBottom'))
|
|
|
+ }
|
|
|
+ }
|
|
|
+ : function() {
|
|
|
+ return {
|
|
|
+ w:self.docscroll[0].scrollWidth,
|
|
|
+ h:self.docscroll[0].scrollHeight
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ this.onResize = function(e,page) {
|
|
|
+
|
|
|
+ if (!self||!self.win) return false;
|
|
|
+
|
|
|
+ if (!self.haswrapper&&!self.ispage) {
|
|
|
+ if (self.win.css('display')=='none') {
|
|
|
+ if (self.visibility) self.hideRail().hideRailHr();
|
|
|
+ return false;
|
|
|
+ } else {
|
|
|
+ if (!self.hidden&&!self.visibility) self.showRail().showRailHr();
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ var premaxh = self.page.maxh;
|
|
|
+ var premaxw = self.page.maxw;
|
|
|
+
|
|
|
+ var preview = {h:self.view.h,w:self.view.w};
|
|
|
+
|
|
|
+ self.view = {
|
|
|
+ w:(self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
|
|
|
+ h:(self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
|
|
|
+ };
|
|
|
+
|
|
|
+ self.page = (page) ? page : self.getContentSize();
|
|
|
+
|
|
|
+ self.page.maxh = Math.max(0,self.page.h - self.view.h);
|
|
|
+ self.page.maxw = Math.max(0,self.page.w - self.view.w);
|
|
|
+
|
|
|
+ if ((self.page.maxh==premaxh)&&(self.page.maxw==premaxw)&&(self.view.w==preview.w)) {
|
|
|
+ // test position
|
|
|
+ if (!self.ispage) {
|
|
|
+ var pos = self.win.offset();
|
|
|
+ if (self.lastposition) {
|
|
|
+ var lst = self.lastposition;
|
|
|
+ if ((lst.top==pos.top)&&(lst.left==pos.left)) return self; //nothing to do
|
|
|
+ }
|
|
|
+ self.lastposition = pos;
|
|
|
+ } else {
|
|
|
+ return self; //nothing to do
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.page.maxh==0) {
|
|
|
+ self.hideRail();
|
|
|
+ self.scrollvaluemax = 0;
|
|
|
+ self.scroll.y = 0;
|
|
|
+ self.scrollratio.y = 0;
|
|
|
+ self.cursorheight = 0;
|
|
|
+ self.setScrollTop(0);
|
|
|
+ self.rail.scrollable = false;
|
|
|
+ } else {
|
|
|
+ self.rail.scrollable = true;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.page.maxw==0) {
|
|
|
+ self.hideRailHr();
|
|
|
+ self.scrollvaluemaxw = 0;
|
|
|
+ self.scroll.x = 0;
|
|
|
+ self.scrollratio.x = 0;
|
|
|
+ self.cursorwidth = 0;
|
|
|
+ self.setScrollLeft(0);
|
|
|
+ self.railh.scrollable = false;
|
|
|
+ } else {
|
|
|
+ self.railh.scrollable = true;
|
|
|
+ }
|
|
|
+
|
|
|
+ self.locked = (self.page.maxh==0)&&(self.page.maxw==0);
|
|
|
+ if (self.locked) {
|
|
|
+ if (!self.ispage) self.updateScrollBar(self.view);
|
|
|
+ return false;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!self.hidden&&!self.visibility) {
|
|
|
+ self.showRail().showRailHr();
|
|
|
+ }
|
|
|
+ else if (!self.hidden&&!self.railh.visibility) self.showRailHr();
|
|
|
+
|
|
|
+ if (self.istextarea&&self.win.css('resize')&&self.win.css('resize')!='none') self.view.h-=20;
|
|
|
+
|
|
|
+ self.cursorheight = Math.min(self.view.h,Math.round(self.view.h * (self.view.h / self.page.h)));
|
|
|
+ self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorheight);
|
|
|
+
|
|
|
+ self.cursorwidth = Math.min(self.view.w,Math.round(self.view.w * (self.view.w / self.page.w)));
|
|
|
+ self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorwidth);
|
|
|
+
|
|
|
+ self.scrollvaluemax = self.view.h-self.cursorheight-self.cursor.hborder;
|
|
|
+
|
|
|
+ if (self.railh) {
|
|
|
+ self.railh.width = (self.page.maxh>0) ? (self.view.w-self.rail.width) : self.view.w;
|
|
|
+ self.scrollvaluemaxw = self.railh.width-self.cursorwidth-self.cursorh.wborder;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.checkrtlmode&&self.railh) {
|
|
|
+ self.checkrtlmode = false;
|
|
|
+ if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!self.ispage) self.updateScrollBar(self.view);
|
|
|
+
|
|
|
+ self.scrollratio = {
|
|
|
+ x:(self.page.maxw/self.scrollvaluemaxw),
|
|
|
+ y:(self.page.maxh/self.scrollvaluemax)
|
|
|
+ };
|
|
|
+
|
|
|
+ var sy = self.getScrollTop();
|
|
|
+ if (sy>self.page.maxh) {
|
|
|
+ self.doScrollTop(self.page.maxh);
|
|
|
+ } else {
|
|
|
+ self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));
|
|
|
+ self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x));
|
|
|
+ if (self.cursoractive) self.noticeCursor();
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.scroll.y&&(self.getScrollTop()==0)) self.doScrollTo(Math.floor(self.scroll.y*self.scrollratio.y));
|
|
|
+
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.resize = self.onResize;
|
|
|
+
|
|
|
+ this.lazyResize = function(tm) { // event debounce
|
|
|
+ tm = (isNaN(tm)) ? 30 : tm;
|
|
|
+ self.delayed('resize',self.resize,tm);
|
|
|
+ return self;
|
|
|
+ }
|
|
|
+
|
|
|
+// modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
|
|
|
+ function _modernWheelEvent(dom,name,fn,bubble) {
|
|
|
+ self._bind(dom,name,function(e){
|
|
|
+ var e = (e) ? e : window.event;
|
|
|
+ var event = {
|
|
|
+ original: e,
|
|
|
+ target: e.target || e.srcElement,
|
|
|
+ type: "wheel",
|
|
|
+ deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
|
|
|
+ deltaX: 0,
|
|
|
+ deltaZ: 0,
|
|
|
+ preventDefault: function() {
|
|
|
+ e.preventDefault ? e.preventDefault() : e.returnValue = false;
|
|
|
+ return false;
|
|
|
+ },
|
|
|
+ stopImmediatePropagation: function() {
|
|
|
+ (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true;
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ if (name=="mousewheel") {
|
|
|
+ event.deltaY = - 1/40 * e.wheelDelta;
|
|
|
+ e.wheelDeltaX && (event.deltaX = - 1/40 * e.wheelDeltaX);
|
|
|
+ } else {
|
|
|
+ event.deltaY = e.detail;
|
|
|
+ }
|
|
|
+
|
|
|
+ return fn.call(dom,event);
|
|
|
+ },bubble);
|
|
|
+ };
|
|
|
+
|
|
|
+ this._bind = function(el,name,fn,bubble) { // primitive bind
|
|
|
+ self.events.push({e:el,n:name,f:fn,b:bubble,q:false});
|
|
|
+ if (el.addEventListener) {
|
|
|
+ el.addEventListener(name,fn,bubble||false);
|
|
|
+ }
|
|
|
+ else if (el.attachEvent) {
|
|
|
+ el.attachEvent("on"+name,fn);
|
|
|
+ }
|
|
|
+ else {
|
|
|
+ el["on"+name] = fn;
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ this.jqbind = function(dom,name,fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
|
|
|
+ self.events.push({e:dom,n:name,f:fn,q:true});
|
|
|
+ $(dom).bind(name,fn);
|
|
|
+ }
|
|
|
+
|
|
|
+ this.bind = function(dom,name,fn,bubble) { // touch-oriented & fixing jquery bind
|
|
|
+ var el = ("jquery" in dom) ? dom[0] : dom;
|
|
|
+
|
|
|
+ if (name=='mousewheel') {
|
|
|
+ if ("onwheel" in self.win) {
|
|
|
+ self._bind(el,"wheel",fn,bubble||false);
|
|
|
+ } else {
|
|
|
+ var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox
|
|
|
+ _modernWheelEvent(el,wname,fn,bubble||false);
|
|
|
+ if (wname=="DOMMouseScroll") _modernWheelEvent(el,"MozMousePixelScroll",fn,bubble||false); // Firefox legacy
|
|
|
+ }
|
|
|
+ }
|
|
|
+ else if (el.addEventListener) {
|
|
|
+ if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support
|
|
|
+ var tt=(name=='mousedown')?'touchstart':(name=='mouseup')?'touchend':'touchmove';
|
|
|
+ self._bind(el,tt,function(e){
|
|
|
+ if (e.touches) {
|
|
|
+ if (e.touches.length<2) {var ev=(e.touches.length)?e.touches[0]:e;ev.original=e;fn.call(this,ev);}
|
|
|
+ }
|
|
|
+ else if (e.changedTouches) {var ev=e.changedTouches[0];ev.original=e;fn.call(this,ev);} //blackberry
|
|
|
+ },bubble||false);
|
|
|
+ }
|
|
|
+ self._bind(el,name,fn,bubble||false);
|
|
|
+ if (cap.cantouch && name=="mouseup") self._bind(el,"touchcancel",fn,bubble||false);
|
|
|
+ }
|
|
|
+ else {
|
|
|
+ self._bind(el,name,function(e) {
|
|
|
+ e = e||window.event||false;
|
|
|
+ if (e) {
|
|
|
+ if (e.srcElement) e.target=e.srcElement;
|
|
|
+ }
|
|
|
+ if (!("pageY" in e)) {
|
|
|
+ e.pageX = e.clientX + document.documentElement.scrollLeft;
|
|
|
+ e.pageY = e.clientY + document.documentElement.scrollTop;
|
|
|
+ }
|
|
|
+ return ((fn.call(el,e)===false)||bubble===false) ? self.cancelEvent(e) : true;
|
|
|
+ });
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ this._unbind = function(el,name,fn,bub) { // primitive unbind
|
|
|
+ if (el.removeEventListener) {
|
|
|
+ el.removeEventListener(name,fn,bub);
|
|
|
+ }
|
|
|
+ else if (el.detachEvent) {
|
|
|
+ el.detachEvent('on'+name,fn);
|
|
|
+ } else {
|
|
|
+ el['on'+name] = false;
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ this.unbindAll = function() {
|
|
|
+ for(var a=0;a<self.events.length;a++) {
|
|
|
+ var r = self.events[a];
|
|
|
+ (r.q) ? r.e.unbind(r.n,r.f) : self._unbind(r.e,r.n,r.f,r.b);
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ // Thanks to http://www.switchonthecode.com !!
|
|
|
+ this.cancelEvent = function(e) {
|
|
|
+ var e = (e.original) ? e.original : (e) ? e : window.event||false;
|
|
|
+ if (!e) return false;
|
|
|
+ if(e.preventDefault) e.preventDefault();
|
|
|
+ if(e.stopPropagation) e.stopPropagation();
|
|
|
+ if(e.preventManipulation) e.preventManipulation(); //IE10
|
|
|
+ e.cancelBubble = true;
|
|
|
+ e.cancel = true;
|
|
|
+ e.returnValue = false;
|
|
|
+ return false;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.stopPropagation = function(e) {
|
|
|
+ var e = (e.original) ? e.original : (e) ? e : window.event||false;
|
|
|
+ if (!e) return false;
|
|
|
+ if (e.stopPropagation) return e.stopPropagation();
|
|
|
+ if (e.cancelBubble) e.cancelBubble=true;
|
|
|
+ return false;
|
|
|
+ }
|
|
|
+
|
|
|
+ this.showRail = function() {
|
|
|
+ if ((self.page.maxh!=0)&&(self.ispage||self.win.css('display')!='none')) {
|
|
|
+ self.visibility = true;
|
|
|
+ self.rail.visibility = true;
|
|
|
+ self.rail.css('display','block');
|
|
|
+ }
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.showRailHr = function() {
|
|
|
+ if (!self.railh) return self;
|
|
|
+ if ((self.page.maxw!=0)&&(self.ispage||self.win.css('display')!='none')) {
|
|
|
+ self.railh.visibility = true;
|
|
|
+ self.railh.css('display','block');
|
|
|
+ }
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.hideRail = function() {
|
|
|
+ self.visibility = false;
|
|
|
+ self.rail.visibility = false;
|
|
|
+ self.rail.css('display','none');
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.hideRailHr = function() {
|
|
|
+ if (!self.railh) return self;
|
|
|
+ self.railh.visibility = false;
|
|
|
+ self.railh.css('display','none');
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.show = function() {
|
|
|
+ self.hidden = false;
|
|
|
+ self.locked = false;
|
|
|
+ return self.showRail().showRailHr();
|
|
|
+ };
|
|
|
+
|
|
|
+ this.hide = function() {
|
|
|
+ self.hidden = true;
|
|
|
+ self.locked = true;
|
|
|
+ return self.hideRail().hideRailHr();
|
|
|
+ };
|
|
|
+
|
|
|
+ this.toggle = function() {
|
|
|
+ return (self.hidden) ? self.show() : self.hide();
|
|
|
+ };
|
|
|
+
|
|
|
+ this.remove = function() {
|
|
|
+ self.stop();
|
|
|
+ if (self.cursortimeout) clearTimeout(self.cursortimeout);
|
|
|
+ self.doZoomOut();
|
|
|
+ self.unbindAll();
|
|
|
+
|
|
|
+ if (cap.isie9) self.win[0].detachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug
|
|
|
+
|
|
|
+ if (self.observer !== false) self.observer.disconnect();
|
|
|
+ if (self.observerremover !== false) self.observerremover.disconnect();
|
|
|
+
|
|
|
+ self.events = null;
|
|
|
+
|
|
|
+ if (self.cursor) {
|
|
|
+ self.cursor.remove();
|
|
|
+ }
|
|
|
+ if (self.cursorh) {
|
|
|
+ self.cursorh.remove();
|
|
|
+ }
|
|
|
+ if (self.rail) {
|
|
|
+ self.rail.remove();
|
|
|
+ }
|
|
|
+ if (self.railh) {
|
|
|
+ self.railh.remove();
|
|
|
+ }
|
|
|
+ if (self.zoom) {
|
|
|
+ self.zoom.remove();
|
|
|
+ }
|
|
|
+ for(var a=0;a<self.saved.css.length;a++) {
|
|
|
+ var d=self.saved.css[a];
|
|
|
+ d[0].css(d[1],(typeof d[2]=="undefined") ? '' : d[2]);
|
|
|
+ }
|
|
|
+ self.saved = false;
|
|
|
+ self.me.data('__nicescroll',''); //erase all traces
|
|
|
+
|
|
|
+ // memory leak fixed by GianlucaGuarini - thanks a lot!
|
|
|
+ // remove the current nicescroll from the $.nicescroll array & normalize array
|
|
|
+ var lst = $.nicescroll;
|
|
|
+ lst.each(function(i){
|
|
|
+ if (!this) return;
|
|
|
+ if(this.id === self.id) {
|
|
|
+ delete lst[i];
|
|
|
+ for(var b=++i;b<lst.length;b++,i++) lst[i]=lst[b];
|
|
|
+ lst.length--;
|
|
|
+ if (lst.length) delete lst[lst.length];
|
|
|
+ }
|
|
|
+ });
|
|
|
+
|
|
|
+ for (var i in self) {
|
|
|
+ self[i] = null;
|
|
|
+ delete self[i];
|
|
|
+ }
|
|
|
+
|
|
|
+ self = null;
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+ this.scrollstart = function(fn) {
|
|
|
+ this.onscrollstart = fn;
|
|
|
+ return self;
|
|
|
+ }
|
|
|
+ this.scrollend = function(fn) {
|
|
|
+ this.onscrollend = fn;
|
|
|
+ return self;
|
|
|
+ }
|
|
|
+ this.scrollcancel = function(fn) {
|
|
|
+ this.onscrollcancel = fn;
|
|
|
+ return self;
|
|
|
+ }
|
|
|
+
|
|
|
+ this.zoomin = function(fn) {
|
|
|
+ this.onzoomin = fn;
|
|
|
+ return self;
|
|
|
+ }
|
|
|
+ this.zoomout = function(fn) {
|
|
|
+ this.onzoomout = fn;
|
|
|
+ return self;
|
|
|
+ }
|
|
|
+
|
|
|
+ this.isScrollable = function(e) {
|
|
|
+ var dom = (e.target) ? e.target : e;
|
|
|
+ if (dom.nodeName == 'OPTION') return true;
|
|
|
+ while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) {
|
|
|
+ var dd = $(dom);
|
|
|
+ var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||'';
|
|
|
+ if (/scroll|auto/.test(ov)) return (dom.clientHeight!=dom.scrollHeight);
|
|
|
+ dom = (dom.parentNode) ? dom.parentNode : false;
|
|
|
+ }
|
|
|
+ return false;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.getViewport = function(me) {
|
|
|
+ var dom = (me&&me.parentNode) ? me.parentNode : false;
|
|
|
+ while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) {
|
|
|
+ var dd = $(dom);
|
|
|
+ if (/fixed|absolute/.test(dd.css("position"))) return dd;
|
|
|
+ var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||'';
|
|
|
+ if ((/scroll|auto/.test(ov))&&(dom.clientHeight!=dom.scrollHeight)) return dd;
|
|
|
+ if (dd.getNiceScroll().length>0) return dd;
|
|
|
+ dom = (dom.parentNode) ? dom.parentNode : false;
|
|
|
+ }
|
|
|
+ return false;
|
|
|
+ };
|
|
|
+
|
|
|
+ function execScrollWheel(e,hr,chkscroll) {
|
|
|
+ var px,py;
|
|
|
+ var rt = 1;
|
|
|
+
|
|
|
+ if (e.deltaMode==0) { // PIXEL
|
|
|
+ px = -Math.floor(e.deltaX*(self.opt.mousescrollstep/(18*3)));
|
|
|
+ py = -Math.floor(e.deltaY*(self.opt.mousescrollstep/(18*3)));
|
|
|
+ }
|
|
|
+ else if (e.deltaMode==1) { // LINE
|
|
|
+ px = -Math.floor(e.deltaX*self.opt.mousescrollstep);
|
|
|
+ py = -Math.floor(e.deltaY*self.opt.mousescrollstep);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (hr&&self.opt.oneaxismousemode&&(px==0)&&py) { // classic vertical-only mousewheel + browser with x/y support
|
|
|
+ px = py;
|
|
|
+ py = 0;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (px) {
|
|
|
+ if (self.scrollmom) {self.scrollmom.stop()}
|
|
|
+ self.lastdeltax+=px;
|
|
|
+ self.debounced("mousewheelx",function(){var dt=self.lastdeltax;self.lastdeltax=0;if(!self.rail.drag){self.doScrollLeftBy(dt)}},120);
|
|
|
+ }
|
|
|
+ if (py) {
|
|
|
+ if (self.opt.nativeparentscrolling&&chkscroll&&!self.ispage&&!self.zoomactive) {
|
|
|
+ if (py<0) {
|
|
|
+ if (self.getScrollTop()>=self.page.maxh) return true;
|
|
|
+ } else {
|
|
|
+ if (self.getScrollTop()<=0) return true;
|
|
|
+ }
|
|
|
+ }
|
|
|
+ if (self.scrollmom) {self.scrollmom.stop()}
|
|
|
+ self.lastdeltay+=py;
|
|
|
+ self.debounced("mousewheely",function(){var dt=self.lastdeltay;self.lastdeltay=0;if(!self.rail.drag){self.doScrollBy(dt)}},120);
|
|
|
+ }
|
|
|
+
|
|
|
+ e.stopImmediatePropagation();
|
|
|
+ return e.preventDefault();
|
|
|
+// return self.cancelEvent(e);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.onmousewheel = function(e) {
|
|
|
+ if (self.locked) {
|
|
|
+ self.debounced("checkunlock",self.resize,250);
|
|
|
+ return true;
|
|
|
+ }
|
|
|
+ if (self.rail.drag) return self.cancelEvent(e);
|
|
|
+
|
|
|
+ if (self.opt.oneaxismousemode=="auto"&&e.deltaX!=0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
|
|
|
+
|
|
|
+ if (self.opt.oneaxismousemode&&e.deltaX==0) {
|
|
|
+ if (!self.rail.scrollable) {
|
|
|
+ if (self.railh&&self.railh.scrollable) {
|
|
|
+ return self.onmousewheelhr(e);
|
|
|
+ } else {
|
|
|
+ return true;
|
|
|
+ }
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ var nw = +(new Date());
|
|
|
+ var chk = false;
|
|
|
+ if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) {
|
|
|
+// self.checkarea = false;
|
|
|
+ self.nativescrollingarea = self.isScrollable(e);
|
|
|
+ chk = true;
|
|
|
+ }
|
|
|
+ self.checkarea = nw;
|
|
|
+ if (self.nativescrollingarea) return true; // this isn't my business
|
|
|
+// if (self.locked) return self.cancelEvent(e);
|
|
|
+ var ret = execScrollWheel(e,false,chk);
|
|
|
+ if (ret) self.checkarea = 0;
|
|
|
+ return ret;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.onmousewheelhr = function(e) {
|
|
|
+ if (self.locked||!self.railh.scrollable) return true;
|
|
|
+ if (self.rail.drag) return self.cancelEvent(e);
|
|
|
+
|
|
|
+ var nw = +(new Date());
|
|
|
+ var chk = false;
|
|
|
+ if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) {
|
|
|
+// self.checkarea = false;
|
|
|
+ self.nativescrollingarea = self.isScrollable(e);
|
|
|
+ chk = true;
|
|
|
+ }
|
|
|
+ self.checkarea = nw;
|
|
|
+ if (self.nativescrollingarea) return true; // this isn't my business
|
|
|
+ if (self.locked) return self.cancelEvent(e);
|
|
|
+
|
|
|
+ return execScrollWheel(e,true,chk);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.stop = function() {
|
|
|
+ self.cancelScroll();
|
|
|
+ if (self.scrollmon) self.scrollmon.stop();
|
|
|
+ self.cursorfreezed = false;
|
|
|
+ self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));
|
|
|
+ self.noticeCursor();
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.getTransitionSpeed = function(dif) {
|
|
|
+ var sp = Math.round(self.opt.scrollspeed*10);
|
|
|
+ var ex = Math.min(sp,Math.round((dif / 20) * self.opt.scrollspeed));
|
|
|
+ return (ex>20) ? ex : 0;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (!self.opt.smoothscroll) {
|
|
|
+ this.doScrollLeft = function(x,spd) { //direct
|
|
|
+ var y = self.getScrollTop();
|
|
|
+ self.doScrollPos(x,y,spd);
|
|
|
+ }
|
|
|
+ this.doScrollTop = function(y,spd) { //direct
|
|
|
+ var x = self.getScrollLeft();
|
|
|
+ self.doScrollPos(x,y,spd);
|
|
|
+ }
|
|
|
+ this.doScrollPos = function(x,y,spd) { //direct
|
|
|
+ var nx = (x>self.page.maxw) ? self.page.maxw : x;
|
|
|
+ if (nx<0) nx=0;
|
|
|
+ var ny = (y>self.page.maxh) ? self.page.maxh : y;
|
|
|
+ if (ny<0) ny=0;
|
|
|
+ self.synched('scroll',function(){
|
|
|
+ self.setScrollTop(ny);
|
|
|
+ self.setScrollLeft(nx);
|
|
|
+ });
|
|
|
+ }
|
|
|
+ this.cancelScroll = function() {}; // direct
|
|
|
+ }
|
|
|
+ else if (self.ishwscroll&&cap.hastransition&&self.opt.usetransition) {
|
|
|
+ this.prepareTransition = function(dif,istime) {
|
|
|
+ var ex = (istime) ? ((dif>20)?dif:0) : self.getTransitionSpeed(dif);
|
|
|
+ var trans = (ex) ? cap.prefixstyle+'transform '+ex+'ms ease-out' : '';
|
|
|
+ if (!self.lasttransitionstyle||self.lasttransitionstyle!=trans) {
|
|
|
+ self.lasttransitionstyle = trans;
|
|
|
+ self.doc.css(cap.transitionstyle,trans);
|
|
|
+ }
|
|
|
+ return ex;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.doScrollLeft = function(x,spd) { //trans
|
|
|
+ var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
|
|
|
+ self.doScrollPos(x,y,spd);
|
|
|
+ }
|
|
|
+
|
|
|
+ this.doScrollTop = function(y,spd) { //trans
|
|
|
+ var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
|
|
|
+ self.doScrollPos(x,y,spd);
|
|
|
+ }
|
|
|
+
|
|
|
+ this.doScrollPos = function(x,y,spd) { //trans
|
|
|
+
|
|
|
+ var py = self.getScrollTop();
|
|
|
+ var px = self.getScrollLeft();
|
|
|
+
|
|
|
+ if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection
|
|
|
+
|
|
|
+ if (self.opt.bouncescroll==false) {
|
|
|
+ if (y<0) y=0;
|
|
|
+ else if (y>self.page.maxh) y=self.page.maxh;
|
|
|
+ if (x<0) x=0;
|
|
|
+ else if (x>self.page.maxw) x=self.page.maxw;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.scrollrunning&&x==self.newscrollx&&y==self.newscrolly) return false;
|
|
|
+
|
|
|
+ self.newscrolly = y;
|
|
|
+ self.newscrollx = x;
|
|
|
+
|
|
|
+ self.newscrollspeed = spd||false;
|
|
|
+
|
|
|
+ if (self.timer) return false;
|
|
|
+
|
|
|
+ self.timer = setTimeout(function(){
|
|
|
+
|
|
|
+ var top = self.getScrollTop();
|
|
|
+ var lft = self.getScrollLeft();
|
|
|
+
|
|
|
+ var dst = {};
|
|
|
+ dst.x = x-lft;
|
|
|
+ dst.y = y-top;
|
|
|
+ dst.px = lft;
|
|
|
+ dst.py = top;
|
|
|
+
|
|
|
+ var dd = Math.round(Math.sqrt(Math.pow(dst.x,2)+Math.pow(dst.y,2)));
|
|
|
+
|
|
|
+// var df = (self.newscrollspeed) ? self.newscrollspeed : dd;
|
|
|
+
|
|
|
+ var ms = (self.newscrollspeed && self.newscrollspeed>1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
|
|
|
+ if (self.newscrollspeed&&self.newscrollspeed<=1) ms*=self.newscrollspeed;
|
|
|
+
|
|
|
+ self.prepareTransition(ms,true);
|
|
|
+
|
|
|
+ if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);
|
|
|
+
|
|
|
+ if (ms>0) {
|
|
|
+
|
|
|
+ if (!self.scrollrunning&&self.onscrollstart) {
|
|
|
+ var info = {"type":"scrollstart","current":{"x":lft,"y":top},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms};
|
|
|
+ self.onscrollstart.call(self,info);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (cap.transitionend) {
|
|
|
+ if (!self.scrollendtrapped) {
|
|
|
+ self.scrollendtrapped = true;
|
|
|
+ self.bind(self.doc,cap.transitionend,self.onScrollEnd,false); //I have got to do something usefull!!
|
|
|
+ }
|
|
|
+ } else {
|
|
|
+ if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
|
|
|
+ self.scrollendtrapped = setTimeout(self.onScrollEnd,ms); // simulate transitionend event
|
|
|
+ }
|
|
|
+
|
|
|
+ var py = top;
|
|
|
+ var px = lft;
|
|
|
+ self.timerscroll = {
|
|
|
+ bz: new BezierClass(py,self.newscrolly,ms,0,0,0.58,1),
|
|
|
+ bh: new BezierClass(px,self.newscrollx,ms,0,0,0.58,1)
|
|
|
+ };
|
|
|
+ if (!self.cursorfreezed) self.timerscroll.tm=setInterval(function(){self.showCursor(self.getScrollTop(),self.getScrollLeft())},60);
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ self.synched("doScroll-set",function(){
|
|
|
+ self.timer = 0;
|
|
|
+ if (self.scrollendtrapped) self.scrollrunning = true;
|
|
|
+ self.setScrollTop(self.newscrolly);
|
|
|
+ self.setScrollLeft(self.newscrollx);
|
|
|
+ if (!self.scrollendtrapped) self.onScrollEnd();
|
|
|
+ });
|
|
|
+
|
|
|
+
|
|
|
+ },50);
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+ this.cancelScroll = function() {
|
|
|
+ if (!self.scrollendtrapped) return true;
|
|
|
+ var py = self.getScrollTop();
|
|
|
+ var px = self.getScrollLeft();
|
|
|
+ self.scrollrunning = false;
|
|
|
+ if (!cap.transitionend) clearTimeout(cap.transitionend);
|
|
|
+ self.scrollendtrapped = false;
|
|
|
+ self._unbind(self.doc,cap.transitionend,self.onScrollEnd);
|
|
|
+ self.prepareTransition(0);
|
|
|
+ self.setScrollTop(py); // fire event onscroll
|
|
|
+ if (self.railh) self.setScrollLeft(px);
|
|
|
+ if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);
|
|
|
+ self.timerscroll = false;
|
|
|
+
|
|
|
+ self.cursorfreezed = false;
|
|
|
+
|
|
|
+ //self.noticeCursor(false,py,px);
|
|
|
+ self.showCursor(py,px);
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+ this.onScrollEnd = function() {
|
|
|
+ if (self.scrollendtrapped) self._unbind(self.doc,cap.transitionend,self.onScrollEnd);
|
|
|
+ self.scrollendtrapped = false;
|
|
|
+ self.prepareTransition(0);
|
|
|
+ if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);
|
|
|
+ self.timerscroll = false;
|
|
|
+ var py = self.getScrollTop();
|
|
|
+ var px = self.getScrollLeft();
|
|
|
+ self.setScrollTop(py); // fire event onscroll
|
|
|
+ if (self.railh) self.setScrollLeft(px); // fire event onscroll left
|
|
|
+
|
|
|
+ self.noticeCursor(false,py,px);
|
|
|
+
|
|
|
+ self.cursorfreezed = false;
|
|
|
+
|
|
|
+ if (py<0) py=0
|
|
|
+ else if (py>self.page.maxh) py=self.page.maxh;
|
|
|
+ if (px<0) px=0
|
|
|
+ else if (px>self.page.maxw) px=self.page.maxw;
|
|
|
+ if((py!=self.newscrolly)||(px!=self.newscrollx)) return self.doScrollPos(px,py,self.opt.snapbackspeed);
|
|
|
+
|
|
|
+ if (self.onscrollend&&self.scrollrunning) {
|
|
|
+ var info = {"type":"scrollend","current":{"x":px,"y":py},"end":{"x":self.newscrollx,"y":self.newscrolly}};
|
|
|
+ self.onscrollend.call(self,info);
|
|
|
+ }
|
|
|
+ self.scrollrunning = false;
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+ } else {
|
|
|
+
|
|
|
+ this.doScrollLeft = function(x,spd) { //no-trans
|
|
|
+ var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
|
|
|
+ self.doScrollPos(x,y,spd);
|
|
|
+ }
|
|
|
+
|
|
|
+ this.doScrollTop = function(y,spd) { //no-trans
|
|
|
+ var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
|
|
|
+ self.doScrollPos(x,y,spd);
|
|
|
+ }
|
|
|
+
|
|
|
+ this.doScrollPos = function(x,y,spd) { //no-trans
|
|
|
+ var y = ((typeof y == "undefined")||(y===false)) ? self.getScrollTop(true) : y;
|
|
|
+
|
|
|
+ if ((self.timer)&&(self.newscrolly==y)&&(self.newscrollx==x)) return true;
|
|
|
+
|
|
|
+ if (self.timer) clearAnimationFrame(self.timer);
|
|
|
+ self.timer = 0;
|
|
|
+
|
|
|
+ var py = self.getScrollTop();
|
|
|
+ var px = self.getScrollLeft();
|
|
|
+
|
|
|
+ if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll(); //inverted movement detection
|
|
|
+
|
|
|
+ self.newscrolly = y;
|
|
|
+ self.newscrollx = x;
|
|
|
+
|
|
|
+ if (!self.bouncescroll||!self.rail.visibility) {
|
|
|
+ if (self.newscrolly<0) {
|
|
|
+ self.newscrolly = 0;
|
|
|
+ }
|
|
|
+ else if (self.newscrolly>self.page.maxh) {
|
|
|
+ self.newscrolly = self.page.maxh;
|
|
|
+ }
|
|
|
+ }
|
|
|
+ if (!self.bouncescroll||!self.railh.visibility) {
|
|
|
+ if (self.newscrollx<0) {
|
|
|
+ self.newscrollx = 0;
|
|
|
+ }
|
|
|
+ else if (self.newscrollx>self.page.maxw) {
|
|
|
+ self.newscrollx = self.page.maxw;
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ self.dst = {};
|
|
|
+ self.dst.x = x-px;
|
|
|
+ self.dst.y = y-py;
|
|
|
+ self.dst.px = px;
|
|
|
+ self.dst.py = py;
|
|
|
+
|
|
|
+ var dst = Math.round(Math.sqrt(Math.pow(self.dst.x,2)+Math.pow(self.dst.y,2)));
|
|
|
+
|
|
|
+ self.dst.ax = self.dst.x / dst;
|
|
|
+ self.dst.ay = self.dst.y / dst;
|
|
|
+
|
|
|
+ var pa = 0;
|
|
|
+ var pe = dst;
|
|
|
+
|
|
|
+ if (self.dst.x==0) {
|
|
|
+ pa = py;
|
|
|
+ pe = y;
|
|
|
+ self.dst.ay = 1;
|
|
|
+ self.dst.py = 0;
|
|
|
+ } else if (self.dst.y==0) {
|
|
|
+ pa = px;
|
|
|
+ pe = x;
|
|
|
+ self.dst.ax = 1;
|
|
|
+ self.dst.px = 0;
|
|
|
+ }
|
|
|
+
|
|
|
+ var ms = self.getTransitionSpeed(dst);
|
|
|
+ if (spd&&spd<=1) ms*=spd;
|
|
|
+ if (ms>0) {
|
|
|
+ self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe,ms) : new BezierClass(pa,pe,ms,0,1,0,1);
|
|
|
+ } else {
|
|
|
+ self.bzscroll = false;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.timer) return;
|
|
|
+
|
|
|
+ if ((py==self.page.maxh&&y>=self.page.maxh)||(px==self.page.maxw&&x>=self.page.maxw)) self.checkContentSize();
|
|
|
+
|
|
|
+ var sync = 1;
|
|
|
+
|
|
|
+ function scrolling() {
|
|
|
+ if (self.cancelAnimationFrame) return true;
|
|
|
+
|
|
|
+ self.scrollrunning = true;
|
|
|
+
|
|
|
+ sync = 1-sync;
|
|
|
+ if (sync) return (self.timer = setAnimationFrame(scrolling)||1);
|
|
|
+
|
|
|
+ var done = 0;
|
|
|
+
|
|
|
+ var sc = sy = self.getScrollTop();
|
|
|
+ if (self.dst.ay) {
|
|
|
+ sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow()*self.dst.ay) : self.newscrolly;
|
|
|
+ var dr=sc-sy;
|
|
|
+ if ((dr<0&&sc<self.newscrolly)||(dr>0&&sc>self.newscrolly)) sc = self.newscrolly;
|
|
|
+ self.setScrollTop(sc);
|
|
|
+ if (sc == self.newscrolly) done=1;
|
|
|
+ } else {
|
|
|
+ done=1;
|
|
|
+ }
|
|
|
+
|
|
|
+ var scx = sx = self.getScrollLeft();
|
|
|
+ if (self.dst.ax) {
|
|
|
+ scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow()*self.dst.ax) : self.newscrollx;
|
|
|
+ var dr=scx-sx;
|
|
|
+ if ((dr<0&&scx<self.newscrollx)||(dr>0&&scx>self.newscrollx)) scx = self.newscrollx;
|
|
|
+ self.setScrollLeft(scx);
|
|
|
+ if (scx == self.newscrollx) done+=1;
|
|
|
+ } else {
|
|
|
+ done+=1;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (done==2) {
|
|
|
+ self.timer = 0;
|
|
|
+ self.cursorfreezed = false;
|
|
|
+ self.bzscroll = false;
|
|
|
+ self.scrollrunning = false;
|
|
|
+ if (sc<0) sc=0;
|
|
|
+ else if (sc>self.page.maxh) sc=self.page.maxh;
|
|
|
+ if (scx<0) scx=0;
|
|
|
+ else if (scx>self.page.maxw) scx=self.page.maxw;
|
|
|
+ if ((scx!=self.newscrollx)||(sc!=self.newscrolly)) self.doScrollPos(scx,sc);
|
|
|
+ else {
|
|
|
+ if (self.onscrollend) {
|
|
|
+ var info = {"type":"scrollend","current":{"x":sx,"y":sy},"end":{"x":self.newscrollx,"y":self.newscrolly}};
|
|
|
+ self.onscrollend.call(self,info);
|
|
|
+ }
|
|
|
+ }
|
|
|
+ } else {
|
|
|
+ self.timer = setAnimationFrame(scrolling)||1;
|
|
|
+ }
|
|
|
+ };
|
|
|
+ self.cancelAnimationFrame=false;
|
|
|
+ self.timer = 1;
|
|
|
+
|
|
|
+ if (self.onscrollstart&&!self.scrollrunning) {
|
|
|
+ var info = {"type":"scrollstart","current":{"x":px,"y":py},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms};
|
|
|
+ self.onscrollstart.call(self,info);
|
|
|
+ }
|
|
|
+
|
|
|
+ scrolling();
|
|
|
+
|
|
|
+ if ((py==self.page.maxh&&y>=py)||(px==self.page.maxw&&x>=px)) self.checkContentSize();
|
|
|
+
|
|
|
+ self.noticeCursor();
|
|
|
+ };
|
|
|
+
|
|
|
+ this.cancelScroll = function() {
|
|
|
+ if (self.timer) clearAnimationFrame(self.timer);
|
|
|
+ self.timer = 0;
|
|
|
+ self.bzscroll = false;
|
|
|
+ self.scrollrunning = false;
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ this.doScrollBy = function(stp,relative) {
|
|
|
+ var ny = 0;
|
|
|
+ if (relative) {
|
|
|
+ ny = Math.floor((self.scroll.y-stp)*self.scrollratio.y)
|
|
|
+ } else {
|
|
|
+ var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
|
|
|
+ ny = sy-stp;
|
|
|
+ }
|
|
|
+ if (self.bouncescroll) {
|
|
|
+ var haf = Math.round(self.view.h/2);
|
|
|
+ if (ny<-haf) ny=-haf
|
|
|
+ else if (ny>(self.page.maxh+haf)) ny = (self.page.maxh+haf);
|
|
|
+ }
|
|
|
+ self.cursorfreezed = false;
|
|
|
+
|
|
|
+ py = self.getScrollTop(true);
|
|
|
+ if (ny<0&&py<=0) return self.noticeCursor();
|
|
|
+ else if (ny>self.page.maxh&&py>=self.page.maxh) {
|
|
|
+ self.checkContentSize();
|
|
|
+ return self.noticeCursor();
|
|
|
+ }
|
|
|
+
|
|
|
+ self.doScrollTop(ny);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.doScrollLeftBy = function(stp,relative) {
|
|
|
+ var nx = 0;
|
|
|
+ if (relative) {
|
|
|
+ nx = Math.floor((self.scroll.x-stp)*self.scrollratio.x)
|
|
|
+ } else {
|
|
|
+ var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
|
|
|
+ nx = sx-stp;
|
|
|
+ }
|
|
|
+ if (self.bouncescroll) {
|
|
|
+ var haf = Math.round(self.view.w/2);
|
|
|
+ if (nx<-haf) nx=-haf
|
|
|
+ else if (nx>(self.page.maxw+haf)) nx = (self.page.maxw+haf);
|
|
|
+ }
|
|
|
+ self.cursorfreezed = false;
|
|
|
+
|
|
|
+ px = self.getScrollLeft(true);
|
|
|
+ if (nx<0&&px<=0) return self.noticeCursor();
|
|
|
+ else if (nx>self.page.maxw&&px>=self.page.maxw) return self.noticeCursor();
|
|
|
+
|
|
|
+ self.doScrollLeft(nx);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.doScrollTo = function(pos,relative) {
|
|
|
+ var ny = (relative) ? Math.round(pos*self.scrollratio.y) : pos;
|
|
|
+ if (ny<0) ny=0
|
|
|
+ else if (ny>self.page.maxh) ny = self.page.maxh;
|
|
|
+ self.cursorfreezed = false;
|
|
|
+ self.doScrollTop(pos);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.checkContentSize = function() {
|
|
|
+ var pg = self.getContentSize();
|
|
|
+ if ((pg.h!=self.page.h)||(pg.w!=self.page.w)) self.resize(false,pg);
|
|
|
+ };
|
|
|
+
|
|
|
+ self.onscroll = function(e) {
|
|
|
+ if (self.rail.drag) return;
|
|
|
+ if (!self.cursorfreezed) {
|
|
|
+ self.synched('scroll',function(){
|
|
|
+ self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));
|
|
|
+ if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x));
|
|
|
+ self.noticeCursor();
|
|
|
+ });
|
|
|
+ }
|
|
|
+ };
|
|
|
+ self.bind(self.docscroll,"scroll",self.onscroll);
|
|
|
+
|
|
|
+ this.doZoomIn = function(e) {
|
|
|
+ if (self.zoomactive) return;
|
|
|
+ self.zoomactive = true;
|
|
|
+
|
|
|
+ self.zoomrestore = {
|
|
|
+ style:{}
|
|
|
+ };
|
|
|
+ var lst = ['position','top','left','zIndex','backgroundColor','marginTop','marginBottom','marginLeft','marginRight'];
|
|
|
+ var win = self.win[0].style;
|
|
|
+ for(var a in lst) {
|
|
|
+ var pp = lst[a];
|
|
|
+ self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : '';
|
|
|
+ }
|
|
|
+
|
|
|
+ self.zoomrestore.style.width = self.win.css('width');
|
|
|
+ self.zoomrestore.style.height = self.win.css('height');
|
|
|
+
|
|
|
+ self.zoomrestore.padding = {
|
|
|
+ w:self.win.outerWidth()-self.win.width(),
|
|
|
+ h:self.win.outerHeight()-self.win.height()
|
|
|
+ };
|
|
|
+
|
|
|
+ if (cap.isios4) {
|
|
|
+ self.zoomrestore.scrollTop = $(window).scrollTop();
|
|
|
+ $(window).scrollTop(0);
|
|
|
+ }
|
|
|
+
|
|
|
+ self.win.css({
|
|
|
+ "position":(cap.isios4)?"absolute":"fixed",
|
|
|
+ "top":0,
|
|
|
+ "left":0,
|
|
|
+ "z-index":globalmaxzindex+100,
|
|
|
+ "margin":"0px"
|
|
|
+ });
|
|
|
+ var bkg = self.win.css("backgroundColor");
|
|
|
+ if (bkg==""||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor","#fff");
|
|
|
+ self.rail.css({"z-index":globalmaxzindex+101});
|
|
|
+ self.zoom.css({"z-index":globalmaxzindex+102});
|
|
|
+ self.zoom.css('backgroundPosition','0px -18px');
|
|
|
+ self.resizeZoom();
|
|
|
+
|
|
|
+ if (self.onzoomin) self.onzoomin.call(self);
|
|
|
+
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.doZoomOut = function(e) {
|
|
|
+ if (!self.zoomactive) return;
|
|
|
+ self.zoomactive = false;
|
|
|
+
|
|
|
+ self.win.css("margin","");
|
|
|
+ self.win.css(self.zoomrestore.style);
|
|
|
+
|
|
|
+ if (cap.isios4) {
|
|
|
+ $(window).scrollTop(self.zoomrestore.scrollTop);
|
|
|
+ }
|
|
|
+
|
|
|
+ self.rail.css({"z-index":self.zindex});
|
|
|
+ self.zoom.css({"z-index":self.zindex});
|
|
|
+ self.zoomrestore = false;
|
|
|
+ self.zoom.css('backgroundPosition','0px 0px');
|
|
|
+ self.onResize();
|
|
|
+
|
|
|
+ if (self.onzoomout) self.onzoomout.call(self);
|
|
|
+
|
|
|
+ return self.cancelEvent(e);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.doZoom = function(e) {
|
|
|
+ return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.resizeZoom = function() {
|
|
|
+ if (!self.zoomactive) return;
|
|
|
+
|
|
|
+ var py = self.getScrollTop(); //preserve scrolling position
|
|
|
+ self.win.css({
|
|
|
+ width:$(window).width()-self.zoomrestore.padding.w+"px",
|
|
|
+ height:$(window).height()-self.zoomrestore.padding.h+"px"
|
|
|
+ });
|
|
|
+ self.onResize();
|
|
|
+
|
|
|
+ self.setScrollTop(Math.min(self.page.maxh,py));
|
|
|
+ };
|
|
|
+
|
|
|
+ this.init();
|
|
|
+
|
|
|
+ $.nicescroll.push(this);
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+// Inspired by the work of Kin Blas
|
|
|
+// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
|
|
|
+
|
|
|
+
|
|
|
+ var ScrollMomentumClass2D = function(nc) {
|
|
|
+ var self = this;
|
|
|
+ this.nc = nc;
|
|
|
+
|
|
|
+ this.lastx = 0;
|
|
|
+ this.lasty = 0;
|
|
|
+ this.speedx = 0;
|
|
|
+ this.speedy = 0;
|
|
|
+ this.lasttime = 0;
|
|
|
+ this.steptime = 0;
|
|
|
+ this.snapx = false;
|
|
|
+ this.snapy = false;
|
|
|
+ this.demulx = 0;
|
|
|
+ this.demuly = 0;
|
|
|
+
|
|
|
+ this.lastscrollx = -1;
|
|
|
+ this.lastscrolly = -1;
|
|
|
+
|
|
|
+ this.chkx = 0;
|
|
|
+ this.chky = 0;
|
|
|
+
|
|
|
+ this.timer = 0;
|
|
|
+
|
|
|
+ this.time = function() {
|
|
|
+ return +new Date();//beautifull hack
|
|
|
+ };
|
|
|
+
|
|
|
+ this.reset = function(px,py) {
|
|
|
+ self.stop();
|
|
|
+ var now = self.time();
|
|
|
+ self.steptime = 0;
|
|
|
+ self.lasttime = now;
|
|
|
+ self.speedx = 0;
|
|
|
+ self.speedy = 0;
|
|
|
+ self.lastx = px;
|
|
|
+ self.lasty = py;
|
|
|
+ self.lastscrollx = -1;
|
|
|
+ self.lastscrolly = -1;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.update = function(px,py) {
|
|
|
+ var now = self.time();
|
|
|
+ self.steptime = now - self.lasttime;
|
|
|
+ self.lasttime = now;
|
|
|
+ var dy = py - self.lasty;
|
|
|
+ var dx = px - self.lastx;
|
|
|
+ var sy = self.nc.getScrollTop();
|
|
|
+ var sx = self.nc.getScrollLeft();
|
|
|
+ var newy = sy + dy;
|
|
|
+ var newx = sx + dx;
|
|
|
+ self.snapx = (newx<0)||(newx>self.nc.page.maxw);
|
|
|
+ self.snapy = (newy<0)||(newy>self.nc.page.maxh);
|
|
|
+ self.speedx = dx;
|
|
|
+ self.speedy = dy;
|
|
|
+ self.lastx = px;
|
|
|
+ self.lasty = py;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.stop = function() {
|
|
|
+ self.nc.unsynched("domomentum2d");
|
|
|
+ if (self.timer) clearTimeout(self.timer);
|
|
|
+ self.timer = 0;
|
|
|
+ self.lastscrollx = -1;
|
|
|
+ self.lastscrolly = -1;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.doSnapy = function(nx,ny) {
|
|
|
+ var snap = false;
|
|
|
+
|
|
|
+ if (ny<0) {
|
|
|
+ ny=0;
|
|
|
+ snap=true;
|
|
|
+ }
|
|
|
+ else if (ny>self.nc.page.maxh) {
|
|
|
+ ny=self.nc.page.maxh;
|
|
|
+ snap=true;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (nx<0) {
|
|
|
+ nx=0;
|
|
|
+ snap=true;
|
|
|
+ }
|
|
|
+ else if (nx>self.nc.page.maxw) {
|
|
|
+ nx=self.nc.page.maxw;
|
|
|
+ snap=true;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (snap) self.nc.doScrollPos(nx,ny,self.nc.opt.snapbackspeed);
|
|
|
+ };
|
|
|
+
|
|
|
+ this.doMomentum = function(gp) {
|
|
|
+ var t = self.time();
|
|
|
+ var l = (gp) ? t+gp : self.lasttime;
|
|
|
+
|
|
|
+ var sl = self.nc.getScrollLeft();
|
|
|
+ var st = self.nc.getScrollTop();
|
|
|
+
|
|
|
+ var pageh = self.nc.page.maxh;
|
|
|
+ var pagew = self.nc.page.maxw;
|
|
|
+
|
|
|
+ self.speedx = (pagew>0) ? Math.min(60,self.speedx) : 0;
|
|
|
+ self.speedy = (pageh>0) ? Math.min(60,self.speedy) : 0;
|
|
|
+
|
|
|
+ var chk = l && (t - l) <= 60;
|
|
|
+
|
|
|
+ if ((st<0)||(st>pageh)||(sl<0)||(sl>pagew)) chk = false;
|
|
|
+
|
|
|
+ var sy = (self.speedy && chk) ? self.speedy : false;
|
|
|
+ var sx = (self.speedx && chk) ? self.speedx : false;
|
|
|
+
|
|
|
+ if (sy||sx) {
|
|
|
+ var tm = Math.max(16,self.steptime); //timeout granularity
|
|
|
+
|
|
|
+ if (tm>50) { // do smooth
|
|
|
+ var xm = tm/50;
|
|
|
+ self.speedx*=xm;
|
|
|
+ self.speedy*=xm;
|
|
|
+ tm = 50;
|
|
|
+ }
|
|
|
+
|
|
|
+ self.demulxy = 0;
|
|
|
+
|
|
|
+ self.lastscrollx = self.nc.getScrollLeft();
|
|
|
+ self.chkx = self.lastscrollx;
|
|
|
+ self.lastscrolly = self.nc.getScrollTop();
|
|
|
+ self.chky = self.lastscrolly;
|
|
|
+
|
|
|
+ var nx = self.lastscrollx;
|
|
|
+ var ny = self.lastscrolly;
|
|
|
+
|
|
|
+ var onscroll = function(){
|
|
|
+ var df = ((self.time()-t)>600) ? 0.04 : 0.02;
|
|
|
+
|
|
|
+ if (self.speedx) {
|
|
|
+ nx = Math.floor(self.lastscrollx - (self.speedx*(1-self.demulxy)));
|
|
|
+ self.lastscrollx = nx;
|
|
|
+ if ((nx<0)||(nx>pagew)) df=0.10;
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.speedy) {
|
|
|
+ ny = Math.floor(self.lastscrolly - (self.speedy*(1-self.demulxy)));
|
|
|
+ self.lastscrolly = ny;
|
|
|
+ if ((ny<0)||(ny>pageh)) df=0.10;
|
|
|
+ }
|
|
|
+
|
|
|
+ self.demulxy = Math.min(1,self.demulxy+df);
|
|
|
+
|
|
|
+ self.nc.synched("domomentum2d",function(){
|
|
|
+
|
|
|
+ if (self.speedx) {
|
|
|
+ var scx = self.nc.getScrollLeft();
|
|
|
+ if (scx!=self.chkx) self.stop();
|
|
|
+ self.chkx=nx;
|
|
|
+ self.nc.setScrollLeft(nx);
|
|
|
+ }
|
|
|
+
|
|
|
+ if (self.speedy) {
|
|
|
+ var scy = self.nc.getScrollTop();
|
|
|
+ if (scy!=self.chky) self.stop();
|
|
|
+ self.chky=ny;
|
|
|
+ self.nc.setScrollTop(ny);
|
|
|
+ }
|
|
|
+
|
|
|
+ if(!self.timer) {
|
|
|
+ self.nc.hideCursor();
|
|
|
+ self.doSnapy(nx,ny);
|
|
|
+ }
|
|
|
+
|
|
|
+ });
|
|
|
+
|
|
|
+ if (self.demulxy<1) {
|
|
|
+ self.timer = setTimeout(onscroll,tm);
|
|
|
+ } else {
|
|
|
+ self.stop();
|
|
|
+ self.nc.hideCursor();
|
|
|
+ self.doSnapy(nx,ny);
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ onscroll();
|
|
|
+
|
|
|
+ } else {
|
|
|
+ self.doSnapy(self.nc.getScrollLeft(),self.nc.getScrollTop());
|
|
|
+ }
|
|
|
+
|
|
|
+ }
|
|
|
+
|
|
|
+ };
|
|
|
+
|
|
|
+
|
|
|
+// override jQuery scrollTop
|
|
|
+
|
|
|
+ var _scrollTop = jQuery.fn.scrollTop; // preserve original function
|
|
|
+
|
|
|
+ jQuery.cssHooks["pageYOffset"] = {
|
|
|
+ get: function(elem,computed,extra) {
|
|
|
+ var nice = $.data(elem,'__nicescroll')||false;
|
|
|
+ return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
|
|
|
+ },
|
|
|
+ set: function(elem,value) {
|
|
|
+ var nice = $.data(elem,'__nicescroll')||false;
|
|
|
+ (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem,value);
|
|
|
+ return this;
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+/*
|
|
|
+ $.fx.step["scrollTop"] = function(fx){
|
|
|
+ $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
|
|
|
+ };
|
|
|
+*/
|
|
|
+
|
|
|
+ jQuery.fn.scrollTop = function(value) {
|
|
|
+ if (typeof value == "undefined") {
|
|
|
+ var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false;
|
|
|
+ return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
|
|
|
+ } else {
|
|
|
+ return this.each(function() {
|
|
|
+ var nice = $.data(this,'__nicescroll')||false;
|
|
|
+ (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this),value);
|
|
|
+ });
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+// override jQuery scrollLeft
|
|
|
+
|
|
|
+ var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
|
|
|
+
|
|
|
+ $.cssHooks.pageXOffset = {
|
|
|
+ get: function(elem,computed,extra) {
|
|
|
+ var nice = $.data(elem,'__nicescroll')||false;
|
|
|
+ return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
|
|
|
+ },
|
|
|
+ set: function(elem,value) {
|
|
|
+ var nice = $.data(elem,'__nicescroll')||false;
|
|
|
+ (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem,value);
|
|
|
+ return this;
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+/*
|
|
|
+ $.fx.step["scrollLeft"] = function(fx){
|
|
|
+ $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
|
|
|
+ };
|
|
|
+*/
|
|
|
+
|
|
|
+ jQuery.fn.scrollLeft = function(value) {
|
|
|
+ if (typeof value == "undefined") {
|
|
|
+ var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false;
|
|
|
+ return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
|
|
|
+ } else {
|
|
|
+ return this.each(function() {
|
|
|
+ var nice = $.data(this,'__nicescroll')||false;
|
|
|
+ (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this),value);
|
|
|
+ });
|
|
|
+ }
|
|
|
+ }
|
|
|
+
|
|
|
+ var NiceScrollArray = function(doms) {
|
|
|
+ var self = this;
|
|
|
+ this.length = 0;
|
|
|
+ this.name = "nicescrollarray";
|
|
|
+
|
|
|
+ this.each = function(fn) {
|
|
|
+ for(var a=0,i=0;a<self.length;a++) fn.call(self[a],i++);
|
|
|
+ return self;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.push = function(nice) {
|
|
|
+ self[self.length]=nice;
|
|
|
+ self.length++;
|
|
|
+ };
|
|
|
+
|
|
|
+ this.eq = function(idx) {
|
|
|
+ return self[idx];
|
|
|
+ };
|
|
|
+
|
|
|
+ if (doms) {
|
|
|
+ for(a=0;a<doms.length;a++) {
|
|
|
+ var nice = $.data(doms[a],'__nicescroll')||false;
|
|
|
+ if (nice) {
|
|
|
+ this[this.length]=nice;
|
|
|
+ this.length++;
|
|
|
+ }
|
|
|
+ };
|
|
|
+ }
|
|
|
+
|
|
|
+ return this;
|
|
|
+ };
|
|
|
+
|
|
|
+ function mplex(el,lst,fn) {
|
|
|
+ for(var a=0;a<lst.length;a++) fn(el,lst[a]);
|
|
|
+ };
|
|
|
+ mplex(
|
|
|
+ NiceScrollArray.prototype,
|
|
|
+ ['show','hide','toggle','onResize','resize','remove','stop','doScrollPos'],
|
|
|
+ function(e,n) {
|
|
|
+ e[n] = function(){
|
|
|
+ var args = arguments;
|
|
|
+ return this.each(function(){
|
|
|
+ this[n].apply(this,args);
|
|
|
+ });
|
|
|
+ };
|
|
|
+ }
|
|
|
+ );
|
|
|
+
|
|
|
+ jQuery.fn.getNiceScroll = function(index) {
|
|
|
+ if (typeof index == "undefined") {
|
|
|
+ return new NiceScrollArray(this);
|
|
|
+ } else {
|
|
|
+ var nice = this[index]&&$.data(this[index],'__nicescroll')||false;
|
|
|
+ return nice;
|
|
|
+ }
|
|
|
+ };
|
|
|
+
|
|
|
+ jQuery.extend(jQuery.expr[':'], {
|
|
|
+ nicescroll: function(a) {
|
|
|
+ return ($.data(a,'__nicescroll'))?true:false;
|
|
|
+ }
|
|
|
+ });
|
|
|
+
|
|
|
+ $.fn.niceScroll = function(wrapper,opt) {
|
|
|
+ if (typeof opt=="undefined") {
|
|
|
+ if ((typeof wrapper=="object")&&!("jquery" in wrapper)) {
|
|
|
+ opt = wrapper;
|
|
|
+ wrapper = false;
|
|
|
+ }
|
|
|
+ }
|
|
|
+ var ret = new NiceScrollArray();
|
|
|
+ if (typeof opt=="undefined") opt = {};
|
|
|
+
|
|
|
+ if (wrapper||false) {
|
|
|
+ opt.doc = $(wrapper);
|
|
|
+ opt.win = $(this);
|
|
|
+ }
|
|
|
+ var docundef = !("doc" in opt);
|
|
|
+ if (!docundef&&!("win" in opt)) opt.win = $(this);
|
|
|
+
|
|
|
+ this.each(function() {
|
|
|
+ var nice = $(this).data('__nicescroll')||false;
|
|
|
+ if (!nice) {
|
|
|
+ opt.doc = (docundef) ? $(this) : opt.doc;
|
|
|
+ nice = new NiceScrollClass(opt,$(this));
|
|
|
+ $(this).data('__nicescroll',nice);
|
|
|
+ }
|
|
|
+ ret.push(nice);
|
|
|
+ });
|
|
|
+ return (ret.length==1) ? ret[0] : ret;
|
|
|
+ };
|
|
|
+
|
|
|
+ window.NiceScroll = {
|
|
|
+ getjQuery:function(){return jQuery}
|
|
|
+ };
|
|
|
+
|
|
|
+ if (!$.nicescroll) {
|
|
|
+ $.nicescroll = new NiceScrollArray();
|
|
|
+ $.nicescroll.options = _globaloptions;
|
|
|
+ }
|
|
|
+
|
|
|
+})( jQuery );
|
|
|
+
|